(S)-diethyl 2-(4-((2,4-diamino-5-methylquinazolin-6-yl)methylamino)benzamido)succinate

ID: ALA3244849

PubChem CID: 90672040

Max Phase: Preclinical

Molecular Formula: C25H30N6O5

Molecular Weight: 494.55

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  CCOC(=O)C[C@H](NC(=O)c1ccc(NCc2ccc3nc(N)nc(N)c3c2C)cc1)C(=O)OCC

Standard InChI:  InChI=1S/C25H30N6O5/c1-4-35-20(32)12-19(24(34)36-5-2)29-23(33)15-6-9-17(10-7-15)28-13-16-8-11-18-21(14(16)3)22(26)31-25(27)30-18/h6-11,19,28H,4-5,12-13H2,1-3H3,(H,29,33)(H4,26,27,30,31)/t19-/m0/s1

Standard InChI Key:  GBLLLPBOUIEBSM-IBGZPJMESA-N

Molfile:  

     RDKit          2D

 36 38  0  0  0  0  0  0  0  0999 V2000
   10.5781   -5.6914    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.2756   -4.4657    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.9813   -5.6914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9813   -4.8743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2756   -6.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5781   -4.8743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6871   -6.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6274   -7.3506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6871   -4.4657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3414   -6.9503    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.3929   -5.6997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7570   -6.9544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8126   -5.7038    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.0472   -7.3630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9216   -6.9420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0986   -6.1124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5101   -6.1207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6274   -8.1678    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.7570   -6.1372    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.3929   -4.8825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2118   -7.3506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9216   -6.1248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5101   -6.9379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2159   -5.7162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8641   -4.4657    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.0389   -8.1802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7447   -8.5888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4628   -7.3630    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.7459   -9.4030    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.4536   -8.1806    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.2735   -6.9172    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.1710   -6.9552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8782   -7.3647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4542   -9.8105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4554  -10.6277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6835   -6.9172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  6  2  0
  3  5  1  0
  4  2  1  0
  5  1  2  0
  6  1  1  0
  7  3  2  0
  8 15  1  0
  9  4  2  0
 10  8  1  0
 11  7  1  0
 12 14  1  0
 13 16  1  0
 14 10  1  6
 15 22  1  0
 16 11  1  0
 17 13  1  0
 18  8  2  0
 19 12  2  0
 20  9  1  0
 21 23  1  0
 22 24  2  0
 23 17  2  0
 24 17  1  0
 25  6  1  0
 26 14  1  0
 27 26  1  0
 28 12  1  0
  3  4  1  0
 11 20  2  0
 21 15  2  0
 27 29  1  0
 27 30  2  0
  5 31  1  0
 28 32  1  0
 32 33  1  0
 29 34  1  0
 34 35  1  0
  7 36  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA3244849

   diethyl (2S)-2-[[4-[(2,4-diamino-5-methylquinazolin-6-yl)methylamino]benzoyl]amino]butanedioate

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 494.55

Molecular Weight (Monoisotopic): 494.2278

AlogP: 2.33

#Rotatable Bonds: 10

Polar Surface Area: 171.55

Molecular Species: NEUTRAL

HBA: 10

HBD: 4

#RO5 Violations: ┄

HBA (Lipinski): 11

HBD (Lipinski): 6

#RO5 Violations (Lipinski): 2

CX Acidic pKa: ┄

CX Basic pKa: 7.86

CX LogP: 2.24

CX LogD: 1.87

Aromatic Rings: 3

Heavy Atoms: 36

QED Weighted: 0.31

Np Likeness Score: -0.73

References

1. Hynes JB, Eason DE, Garrett CM, Colvin PL..  (1977)  Quinazolines as inhibitors of dihydrofolate reductase. 4. Classical analogues of folic and isofolic acids.,  20  (4): [PMID:850245] [10.1021/jm00214a030]

Source

Source(1):

• Scientific Literature