(S)-diethyl 2-(4-((2,4-diamino-5-chloroquinazolin-6-yl)methylamino)benzamido)pentanedioate

ID: ALA3244852

PubChem CID: 90672042

Max Phase: Preclinical

Molecular Formula: C25H29ClN6O5

Molecular Weight: 529.00

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  CCOC(=O)CC[C@H](NC(=O)c1ccc(NCc2ccc3nc(N)nc(N)c3c2Cl)cc1)C(=O)OCC

Standard InChI:  InChI=1S/C25H29ClN6O5/c1-3-36-19(33)12-11-18(24(35)37-4-2)30-23(34)14-5-8-16(9-6-14)29-13-15-7-10-17-20(21(15)26)22(27)32-25(28)31-17/h5-10,18,29H,3-4,11-13H2,1-2H3,(H,30,34)(H4,27,28,31,32)/t18-/m0/s1

Standard InChI Key:  KGFFIMOYCUIMHZ-SFHVURJKSA-N

Molfile:  

     RDKit          2D

 37 39  0  0  0  0  0  0  0  0999 V2000
   21.1149  -12.8687    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.8124  -11.6429    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.5182  -12.8687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5182  -12.0515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8124  -13.2773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1149  -12.0515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2239  -13.2773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1642  -14.5278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2239  -11.6429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8782  -14.1275    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.9297  -12.8770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2939  -14.1316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3494  -12.8811    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.5840  -14.5402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4585  -14.1192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6354  -13.2897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0469  -13.2979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1642  -15.3450    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.2939  -13.3144    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.9297  -12.0598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7486  -14.5278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4585  -13.3021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0469  -14.1151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7527  -12.8935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4009  -11.6429    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.5757  -15.3574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2815  -15.7660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9996  -14.5402    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.8103  -14.0945    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.7078  -14.1325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4150  -14.5419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2805  -16.5832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5722  -16.9946    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.9876  -16.9963    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.8634  -16.5879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1568  -16.9984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2203  -14.0945    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  6  2  0
  3  5  1  0
  4  2  1  0
  5  1  2  0
  6  1  1  0
  7  3  2  0
  8 15  1  0
  9  4  2  0
 10  8  1  0
 11  7  1  0
 12 14  1  0
 13 16  1  0
 14 10  1  6
 15 22  1  0
 16 11  1  0
 17 13  1  0
 18  8  2  0
 19 12  2  0
 20  9  1  0
 21 23  1  0
 22 24  2  0
 23 17  2  0
 24 17  1  0
 25  6  1  0
 26 14  1  0
 27 26  1  0
 28 12  1  0
  3  4  1  0
 11 20  2  0
 21 15  2  0
  5 29  1  0
 28 30  1  0
 30 31  1  0
 27 32  1  0
 32 33  1  0
 32 34  2  0
 33 35  1  0
 35 36  1  0
  7 37  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA3244852

   diethyl (2S)-2-[[4-[(2,4-diamino-5-chloroquinazolin-6-yl)methylamino]benzoyl]amino]pentanedioate

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 529.00

Molecular Weight (Monoisotopic): 528.1888

AlogP: 3.06

#Rotatable Bonds: 11

Polar Surface Area: 171.55

Molecular Species: NEUTRAL

HBA: 10

HBD: 4

#RO5 Violations: 1

HBA (Lipinski): 11

HBD (Lipinski): 6

#RO5 Violations (Lipinski): 3

CX Acidic pKa: ┄

CX Basic pKa: 6.72

CX LogP: 2.62

CX LogD: 2.57

Aromatic Rings: 3

Heavy Atoms: 37

QED Weighted: 0.27

Np Likeness Score: -0.77

References

1. Hynes JB, Eason DE, Garrett CM, Colvin PL..  (1977)  Quinazolines as inhibitors of dihydrofolate reductase. 4. Classical analogues of folic and isofolic acids.,  20  (4): [PMID:850245] [10.1021/jm00214a030]

Source

Source(1):

• Scientific Literature