The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N4-(5-(2,5-dichlorophenylthio)-6-methoxyquinolin-8-yl)pentane-1,4-diamine ID: ALA3245216
PubChem CID: 633200
Max Phase: Preclinical
Molecular Formula: C21H23Cl2N3OS
Molecular Weight: 436.41
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(NC(C)CCCN)c2ncccc2c1Sc1cc(Cl)ccc1Cl
Standard InChI: InChI=1S/C21H23Cl2N3OS/c1-13(5-3-9-24)26-17-12-18(27-2)21(15-6-4-10-25-20(15)17)28-19-11-14(22)7-8-16(19)23/h4,6-8,10-13,26H,3,5,9,24H2,1-2H3
Standard InChI Key: BCHIRTCLRJSMPT-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 30 0 0 0 0 0 0 0 0999 V2000
1.7319 -12.2169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7308 -13.0443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4456 -13.4572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4438 -11.8041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1592 -12.2133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1600 -13.0401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8753 -13.4511 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.5904 -13.0364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5856 -12.2063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8697 -11.7991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0174 -11.8046 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0172 -10.9796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4475 -14.2822 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7340 -14.6963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7359 -15.5214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0186 -14.2855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4514 -15.9323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1648 -15.5180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8803 -15.9289 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4414 -10.9791 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.1546 -10.5644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8682 -10.9772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5810 -10.5633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5789 -9.7374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8582 -9.3272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1484 -9.7435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4310 -9.3362 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
5.2965 -10.9740 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
1 11 1 0
11 12 1 0
3 13 1 0
13 14 1 0
14 15 1 0
14 16 1 0
15 17 1 0
17 18 1 0
18 19 1 0
4 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
26 27 1 0
23 28 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 436.41Molecular Weight (Monoisotopic): 435.0939AlogP: 6.24#Rotatable Bonds: 8Polar Surface Area: 60.17Molecular Species: BASEHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 10.20CX LogP: 5.04CX LogD: 2.44Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.44Np Likeness Score: -0.76
References 1. Tanabe K, Chen EH, Verma BL, Saggiomo AJ, Nodiff EA.. (1978) Modifications of primiaquine as antimalarials. 2. 5-Phenylthio and 5-anilino derivatives of primaquine., 21 (1): [PMID:412967 ] [10.1021/jm00199a028 ]