The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6'-N-tert-Butylsisomicin ID: ALA3245221
PubChem CID: 90672128
Max Phase: Preclinical
Molecular Formula: C23H45N5O7
Molecular Weight: 503.64
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CN[C@@H]1[C@@H](O)[C@@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3OC(CNC(C)(C)C)=CC[C@H]3N)[C@@H](N)C[C@H]2N)OC[C@]1(C)O
Standard InChI: InChI=1S/C23H45N5O7/c1-22(2,3)28-9-11-6-7-12(24)20(33-11)34-17-13(25)8-14(26)18(15(17)29)35-21-16(30)19(27-5)23(4,31)10-32-21/h6,12-21,27-31H,7-10,24-26H2,1-5H3/t12-,13+,14-,15+,16-,17-,18+,19-,20-,21-,23+/m1/s1
Standard InChI Key: ICBFOQQTUKGTTQ-QZLJUJNXSA-N
Molfile:
RDKit 2D
37 39 0 0 0 0 0 0 0 0999 V2000
13.7243 -16.0534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2773 -15.2751 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.2243 -17.4080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3065 -16.1055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9731 -14.8478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2563 -18.2225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3906 -14.8108 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.6040 -16.5222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0215 -16.4852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9466 -17.7865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6949 -15.2382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6367 -17.3503 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.9809 -18.6049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9507 -14.0309 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.9897 -13.7019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7227 -14.9098 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.4017 -13.6686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3768 -12.8522 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.2300 -12.8105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1717 -14.4434 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
8.6645 -12.4607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0432 -13.3979 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
7.2899 -14.1268 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.5385 -14.0435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5735 -13.7353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9689 -12.8855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9480 -12.0650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9173 -12.2066 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.2524 -12.4981 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7061 -14.0935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8221 -13.6478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8096 -12.8313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1057 -12.4231 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.1182 -14.0601 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5136 -12.4106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2425 -13.6228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5511 -14.8599 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 5 1 0
10 6 1 0
11 5 1 0
9 4 2 0
1 11 1 0
11 7 1 6
8 4 1 0
10 13 1 0
12 8 1 0
9 1 1 0
4 2 1 0
12 10 1 0
10 3 1 0
5 14 1 6
25 23 1 0
24 31 1 0
21 18 1 0
31 22 1 6
36 24 1 0
32 33 1 6
19 36 1 0
18 17 1 0
17 34 1 6
30 17 1 0
26 15 1 0
14 36 1 0
36 20 1 6
19 28 1 6
26 29 1 1
34 31 1 0
27 26 1 0
24 37 1 6
35 32 1 0
30 16 1 6
32 31 1 0
15 23 1 1
19 35 1 0
15 30 1 0
21 26 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 503.64Molecular Weight (Monoisotopic): 503.3319AlogP: -2.42#Rotatable Bonds: 7Polar Surface Area: 199.73Molecular Species: BASEHBA: 12HBD: 8#RO5 Violations: 3HBA (Lipinski): 12HBD (Lipinski): 11#RO5 Violations (Lipinski): 3CX Acidic pKa: 12.55CX Basic pKa: 9.73CX LogP: -2.83CX LogD: -10.29Aromatic Rings: ┄Heavy Atoms: 35QED Weighted: 0.18Np Likeness Score: 1.47
References 1. Davies DH, Mallams AK, Counelis M, Loebenberg D, Moss EL, Waitz JA.. (1978) Semisynthetic aminoglycoside antibacterials. 6. Synthesis of sisomicin, Antibiotic G-52, and novel 6'-substituted analogues of sisomicin from aminoglycoside 66-40C., 21 (2): [PMID:413921 ] [10.1021/jm00200a009 ]