The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6'-N-(2-Phenylethyl)sisomicin ID: ALA3245222
PubChem CID: 90672129
Max Phase: Preclinical
Molecular Formula: C27H45N5O7
Molecular Weight: 551.68
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CN[C@@H]1[C@@H](O)[C@@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3OC(CNCCc4ccccc4)=CC[C@H]3N)[C@@H](N)C[C@H]2N)OC[C@]1(C)O
Standard InChI: InChI=1S/C27H45N5O7/c1-27(35)14-36-26(21(34)24(27)31-2)39-23-19(30)12-18(29)22(20(23)33)38-25-17(28)9-8-16(37-25)13-32-11-10-15-6-4-3-5-7-15/h3-8,17-26,31-35H,9-14,28-30H2,1-2H3/t17-,18+,19-,20+,21-,22-,23+,24-,25-,26-,27+/m1/s1
Standard InChI Key: KAXRXPAMDOAIAY-DBTGHZAVSA-N
Molfile:
RDKit 2D
41 44 0 0 0 0 0 0 0 0999 V2000
12.1887 -14.1803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2535 -19.0688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9661 -19.4684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2420 -18.2607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4837 -14.5923 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.6706 -19.0473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7978 -16.6531 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.9017 -14.5862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4947 -15.4232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2014 -15.8184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9134 -15.4020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6067 -14.1742 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.6537 -18.2275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9403 -17.8340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7832 -15.8245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5282 -17.8664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5138 -17.0510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9700 -14.2458 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8206 -13.0711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0695 -12.9836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0570 -12.1671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2368 -13.0378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1941 -13.3669 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.4900 -12.9586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6241 -12.1880 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3613 -13.3961 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3489 -11.7589 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.4775 -12.1463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4150 -13.7793 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
7.9533 -13.4294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7610 -11.7464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5370 -13.4627 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.6490 -13.0045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1952 -11.4007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7985 -14.1958 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4953 -11.8338 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.7860 -13.3793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1648 -11.5464 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.9117 -11.7964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2906 -12.7378 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
7.2160 -12.2213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9 5 1 0
16 4 1 0
15 9 1 0
10 11 1 0
8 1 1 0
4 14 2 0
10 9 2 0
14 13 1 0
5 1 1 0
7 15 1 0
6 3 1 0
13 6 2 0
2 4 1 0
17 16 1 0
8 12 1 6
11 8 1 0
3 2 2 0
7 17 1 0
30 33 1 0
28 31 1 0
31 21 1 0
37 35 1 6
24 29 1 6
39 41 1 0
34 41 1 0
22 30 1 0
22 32 1 1
25 33 1 0
26 20 1 0
41 36 1 1
39 25 1 0
23 24 1 0
28 38 1 6
24 37 1 0
41 22 1 0
20 40 1 6
33 26 1 6
28 24 1 0
21 27 1 6
19 32 1 0
30 18 1 6
21 20 1 0
37 20 1 0
1 23 1 6
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 551.68Molecular Weight (Monoisotopic): 551.3319AlogP: -1.98#Rotatable Bonds: 10Polar Surface Area: 199.73Molecular Species: BASEHBA: 12HBD: 8#RO5 Violations: 3HBA (Lipinski): 12HBD (Lipinski): 11#RO5 Violations (Lipinski): 3CX Acidic pKa: 12.55CX Basic pKa: 9.73CX LogP: -1.87CX LogD: -8.95Aromatic Rings: 1Heavy Atoms: 39QED Weighted: 0.15Np Likeness Score: 1.28
References 1. Davies DH, Mallams AK, Counelis M, Loebenberg D, Moss EL, Waitz JA.. (1978) Semisynthetic aminoglycoside antibacterials. 6. Synthesis of sisomicin, Antibiotic G-52, and novel 6'-substituted analogues of sisomicin from aminoglycoside 66-40C., 21 (2): [PMID:413921 ] [10.1021/jm00200a009 ]