The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6'-N-(2-Hydroxyethyl)sisomicin ID: ALA3245223
PubChem CID: 90672130
Max Phase: Preclinical
Molecular Formula: C21H41N5O8
Molecular Weight: 491.59
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CN[C@@H]1[C@@H](O)[C@@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3OC(CNCCO)=CC[C@H]3N)[C@@H](N)C[C@H]2N)OC[C@]1(C)O
Standard InChI: InChI=1S/C21H41N5O8/c1-21(30)9-31-20(15(29)18(21)25-2)34-17-13(24)7-12(23)16(14(17)28)33-19-11(22)4-3-10(32-19)8-26-5-6-27/h3,11-20,25-30H,4-9,22-24H2,1-2H3/t11-,12+,13-,14+,15-,16-,17+,18-,19-,20-,21+/m1/s1
Standard InChI Key: DWSIEZPHSFCNAT-MQDUPKMGSA-N
Molfile:
RDKit 2D
36 38 0 0 0 0 0 0 0 0999 V2000
14.4215 -13.7428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7165 -14.1548 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.0307 -16.2156 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.1346 -14.1487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7275 -14.9857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4342 -15.3809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1463 -14.9646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8396 -13.7367 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.0161 -15.3870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7611 -17.4289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7466 -16.6135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2028 -13.8084 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.0534 -12.6336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3023 -12.5461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2898 -11.7296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4697 -12.6003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4269 -12.9294 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.7229 -12.5212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8569 -11.7505 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5941 -12.9586 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5817 -11.3214 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.7103 -11.7088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6479 -13.3418 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
10.1861 -12.9919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9939 -11.3089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7699 -13.0252 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.8818 -12.5670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4280 -10.9632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0313 -13.7583 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7282 -11.3963 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.0188 -12.9418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3976 -11.1089 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.1446 -11.3589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5234 -12.3003 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
9.4489 -11.7838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4759 -17.8250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5 2 1 0
9 5 1 0
6 7 1 0
4 1 1 0
6 5 2 0
2 1 1 0
3 9 1 0
11 10 1 0
4 8 1 6
7 4 1 0
3 11 1 0
24 27 1 0
22 25 1 0
25 15 1 0
31 29 1 6
18 23 1 6
33 35 1 0
28 35 1 0
16 24 1 0
16 26 1 1
19 27 1 0
20 14 1 0
35 30 1 1
33 19 1 0
17 18 1 0
22 32 1 6
18 31 1 0
35 16 1 0
14 34 1 6
27 20 1 6
22 18 1 0
15 21 1 6
13 26 1 0
24 12 1 6
15 14 1 0
31 14 1 0
1 17 1 6
10 36 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 491.59Molecular Weight (Monoisotopic): 491.2955AlogP: -4.23#Rotatable Bonds: 9Polar Surface Area: 219.96Molecular Species: BASEHBA: 13HBD: 9#RO5 Violations: 2HBA (Lipinski): 13HBD (Lipinski): 12#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.55CX Basic pKa: 9.59CX LogP: -4.58CX LogD: -11.32Aromatic Rings: ┄Heavy Atoms: 34QED Weighted: 0.14Np Likeness Score: 1.66
References 1. Davies DH, Mallams AK, Counelis M, Loebenberg D, Moss EL, Waitz JA.. (1978) Semisynthetic aminoglycoside antibacterials. 6. Synthesis of sisomicin, Antibiotic G-52, and novel 6'-substituted analogues of sisomicin from aminoglycoside 66-40C., 21 (2): [PMID:413921 ] [10.1021/jm00200a009 ]