The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
O-2-Amino-6-(morpholinoazylene)-2,3,4,6-tetradeoxy-alpha-D-glycero-hex-4-enopyranosyl(1->4)garamine ID: ALA3245235
PubChem CID: 90672140
Max Phase: Preclinical
Molecular Formula: C23H42N6O8
Molecular Weight: 530.62
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CN[C@@H]1[C@@H](O)[C@@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3OC(/C=N/N4CCOCC4)=CC[C@H]3N)[C@@H](N)C[C@H]2N)OC[C@]1(C)O
Standard InChI: InChI=1S/C23H42N6O8/c1-23(32)11-34-22(17(31)20(23)27-2)37-19-15(26)9-14(25)18(16(19)30)36-21-13(24)4-3-12(35-21)10-28-29-5-7-33-8-6-29/h3,10,13-22,27,30-32H,4-9,11,24-26H2,1-2H3/b28-10+/t13-,14+,15-,16+,17-,18-,19+,20-,21-,22-,23+/m1/s1
Standard InChI Key: PVVJGFYTMUKJEB-CKACLPFOSA-N
Molfile:
RDKit 2D
39 42 0 0 0 0 0 0 0 0999 V2000
12.8863 -15.1617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7095 -17.8298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7848 -16.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2198 -16.4283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4868 -19.0288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4033 -17.3793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1762 -18.5830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1564 -14.7725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1346 -17.7589 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.4911 -16.0486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5855 -14.7246 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.4570 -15.2095 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.9262 -15.9867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8282 -17.3130 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.7542 -18.6552 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8668 -14.0064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1015 -11.9558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4377 -14.0402 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.9894 -12.7337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7040 -12.3067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4397 -13.5329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3636 -14.3616 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
8.5687 -13.5794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7293 -13.9557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2157 -13.3087 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
12.2219 -11.9388 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.1227 -12.7844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2918 -13.9725 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3954 -12.3954 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.2791 -12.3193 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.4270 -12.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7147 -13.6428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1438 -13.6090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8838 -14.8309 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.1543 -13.9430 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.7420 -14.7801 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.0021 -13.5581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5476 -12.7549 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8245 -12.3574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 8 1 0
12 8 1 0
4 10 2 0
14 9 1 0
14 3 2 0
15 2 1 0
9 7 1 0
5 15 1 0
2 6 1 0
10 12 1 0
7 5 1 0
3 10 1 0
1 11 1 6
4 13 1 0
13 1 1 0
9 6 1 0
27 29 1 1
39 27 1 0
19 30 1 6
27 33 1 0
24 37 1 0
31 20 1 0
16 23 1 0
19 37 1 0
32 18 1 0
33 18 1 1
24 36 1 6
16 34 1 6
33 16 1 0
21 22 1 6
28 37 1 0
20 19 1 0
17 27 1 0
31 26 1 6
38 23 1 0
21 24 1 0
35 21 1 0
39 38 1 0
31 21 1 0
37 25 1 6
23 28 1 6
8 35 1 6
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 530.62Molecular Weight (Monoisotopic): 530.3064AlogP: -3.49#Rotatable Bonds: 7Polar Surface Area: 212.53Molecular Species: BASEHBA: 14HBD: 7#RO5 Violations: 3HBA (Lipinski): 14HBD (Lipinski): 10#RO5 Violations (Lipinski): 3CX Acidic pKa: 12.55CX Basic pKa: 9.68CX LogP: -4.23CX LogD: -9.93Aromatic Rings: ┄Heavy Atoms: 37QED Weighted: 0.16Np Likeness Score: 0.98
References 1. Davies DH, Mallams AK, Counelis M, Loebenberg D, Moss EL, Waitz JA.. (1978) Semisynthetic aminoglycoside antibacterials. 6. Synthesis of sisomicin, Antibiotic G-52, and novel 6'-substituted analogues of sisomicin from aminoglycoside 66-40C., 21 (2): [PMID:413921 ] [10.1021/jm00200a009 ]