The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(6aR,9S)-9-(4-methoxyphenyl)-7-methyl-4,6,6a,7,8,9-hexahydroindolo[4,3-fg]quinoline maleate ID: ALA3245284
PubChem CID: 90672164
Max Phase: Preclinical
Molecular Formula: C26H26N2O5
Molecular Weight: 330.43
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc([C@@H]2C=C3c4cccc5[nH]cc(c45)C[C@H]3N(C)C2)cc1.O=C(O)/C=C\C(=O)O
Standard InChI: InChI=1S/C22H22N2O.C4H4O4/c1-24-13-16(14-6-8-17(25-2)9-7-14)10-19-18-4-3-5-20-22(18)15(12-23-20)11-21(19)24;5-3(6)1-2-4(7)8/h3-10,12,16,21,23H,11,13H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1-/t16-,21-;/m1./s1
Standard InChI Key: MRTCCSXPTRVSSH-HYTRZONSSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
10.5283 -8.1559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1186 -8.8657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2990 -8.8657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8892 -8.1559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1186 -7.4462 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.3479 -8.1559 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.0697 -8.1559 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.2990 -7.4462 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.2644 -8.7208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2633 -9.5403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9695 -8.3119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9704 -9.9477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2226 -10.7275 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0422 -10.7287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2965 -9.9496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6782 -8.7172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1075 -9.5365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6857 -9.5421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3872 -8.2994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1060 -8.7108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8177 -8.2963 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.8169 -7.4686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0980 -7.0572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3800 -7.4735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5264 -8.7031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0958 -6.2400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8111 -9.1170 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
5.8006 -5.8320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7987 -5.0156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0893 -4.6082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3804 -5.0231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3858 -5.8382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0860 -3.7910 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7920 -3.3795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
1 5 2 0
1 6 1 0
4 7 2 0
4 8 1 0
9 10 2 0
10 12 1 0
16 11 2 0
11 9 1 0
18 12 2 0
12 13 1 0
13 14 1 0
14 15 2 0
16 18 1 0
16 19 1 0
15 17 1 0
17 20 1 0
15 18 1 0
19 20 1 0
19 24 2 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
21 25 1 0
23 26 1 1
20 27 1 1
26 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 26 1 0
30 33 1 0
33 34 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 330.43Molecular Weight (Monoisotopic): 330.1732AlogP: 4.21#Rotatable Bonds: 2Polar Surface Area: 28.26Molecular Species: NEUTRALHBA: 2HBD: 1#RO5 Violations: ┄HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.42CX LogP: 3.89CX LogD: 2.84Aromatic Rings: 3Heavy Atoms: 25QED Weighted: 0.76Np Likeness Score: 0.84
References 1. Bach NJ, Kornfeld EC, Dorman DE.. (1977) Synthesis and biological activity of 8-arylergolines., 20 (8): [PMID:561190 ] [10.1021/jm00218a025 ]