The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(6aR,9R)-7-methyl-9-phenyl-4,6,6a,7,8,9-hexahydroindolo[4,3-fg]quinoline maleate ID: ALA3245289
PubChem CID: 90672169
Max Phase: Preclinical
Molecular Formula: C25H24N2O4
Molecular Weight: 300.40
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CN1C[C@@H](c2ccccc2)C=C2c3cccc4[nH]cc(c34)C[C@H]21.O=C(O)/C=C\C(=O)O
Standard InChI: InChI=1S/C21H20N2.C4H4O4/c1-23-13-16(14-6-3-2-4-7-14)10-18-17-8-5-9-19-21(17)15(12-22-19)11-20(18)23;5-3(6)1-2-4(7)8/h2-10,12,16,20,22H,11,13H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1-/t16-,20+;/m0./s1
Standard InChI Key: QHVLEEQTUJJDTQ-DEJBJBBRSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
10.5977 -8.2096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1853 -8.9241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3603 -8.9241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9478 -8.2096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1853 -7.4953 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.4227 -8.2096 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1229 -8.2096 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3603 -7.4953 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9939 -8.5913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9928 -9.4162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7036 -8.1797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7045 -9.8263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9584 -10.6113 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7834 -10.6125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0393 -9.8281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4169 -8.5877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8557 -9.4124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4246 -9.4180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1306 -8.1672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8542 -8.5813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5706 -8.1639 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5698 -7.3309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8462 -6.9168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1234 -7.3357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2840 -8.5735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8439 -6.0942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5640 -8.9901 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
6.5534 -5.6835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1238 -4.8693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1293 -5.6897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8374 -4.4516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5498 -4.8647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
1 5 2 0
1 6 1 0
4 7 2 0
4 8 1 0
9 10 2 0
10 12 1 0
16 11 2 0
11 9 1 0
18 12 2 0
12 13 1 0
13 14 1 0
14 15 2 0
16 18 1 0
16 19 1 0
15 17 1 0
17 20 1 0
15 18 1 0
19 20 1 0
19 24 2 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
21 25 1 0
23 26 1 6
20 27 1 1
26 28 2 0
28 32 1 0
31 29 1 0
29 30 2 0
30 26 1 0
31 32 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 300.40Molecular Weight (Monoisotopic): 300.1626AlogP: 4.21#Rotatable Bonds: 1Polar Surface Area: 19.03Molecular Species: BASEHBA: 1HBD: 1#RO5 Violations: ┄HBA (Lipinski): 2HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.56CX LogP: 4.05CX LogD: 2.86Aromatic Rings: 3Heavy Atoms: 23QED Weighted: 0.71Np Likeness Score: 0.93
References 1. Bach NJ, Kornfeld EC, Dorman DE.. (1977) Synthesis and biological activity of 8-arylergolines., 20 (8): [PMID:561190 ] [10.1021/jm00218a025 ]