The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7,8-dihydro-11-thiohomofolic acid ID: ALA3245580
PubChem CID: 136502413
Max Phase: Preclinical
Molecular Formula: C20H22N6O6S
Molecular Weight: 474.50
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Nc1nc(=O)c2c([nH]1)NCC(CCSc1ccc(C(=O)N[C@@H](CCC(=O)O)C(=O)O)cc1)=N2
Standard InChI: InChI=1S/C20H22N6O6S/c21-20-25-16-15(18(30)26-20)23-11(9-22-16)7-8-33-12-3-1-10(2-4-12)17(29)24-13(19(31)32)5-6-14(27)28/h1-4,13H,5-9H2,(H,24,29)(H,27,28)(H,31,32)(H4,21,22,25,26,30)/t13-/m0/s1
Standard InChI Key: ULIQZSQMVSOUFB-ZDUSSCGKSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
8.8491 -10.6077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1348 -11.0247 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.4211 -9.7845 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.7036 -9.7652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2857 -11.8048 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.4200 -10.6118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0215 -14.6868 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.4320 -12.2013 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.9866 -9.3571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2979 -13.4547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1331 -10.5814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8491 -10.9895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7146 -11.7942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5926 -14.6974 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.5544 -9.7434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1305 -8.5468 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.3041 -14.2796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1324 -9.7565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4155 -9.3484 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
9.5588 -9.3668 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.2795 -10.9798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1329 -9.3717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7084 -10.9692 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.2747 -9.7739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0093 -13.0369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5620 -10.5726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9909 -10.5620 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.8377 -9.3391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0032 -12.2119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8484 -9.7809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5645 -11.0187 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.7052 -11.0238 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.2794 -10.6039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30 22 1 0
21 27 2 0
31 33 1 0
26 15 1 0
22 3 1 0
28 18 1 0
6 32 1 0
15 28 2 0
20 30 1 0
18 11 2 0
26 21 1 0
12 26 2 0
25 10 1 0
13 8 1 0
4 19 1 0
10 17 1 0
2 1 1 0
19 18 1 0
17 14 2 0
9 4 1 0
29 13 1 0
17 7 1 0
1 31 1 0
21 5 1 0
13 23 2 0
22 16 2 0
29 5 1 6
30 1 2 0
24 9 1 0
3 6 2 0
24 20 2 0
11 12 1 0
29 25 1 0
33 24 1 0
6 2 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 474.50Molecular Weight (Monoisotopic): 474.1322AlogP: 1.08#Rotatable Bonds: 10Polar Surface Area: 199.86Molecular Species: ACIDHBA: 9HBD: 6#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 7#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.13CX Basic pKa: 3.58CX LogP: -1.08CX LogD: -6.85Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.27Np Likeness Score: -0.24
References 1. Nair MG, Chen SY, Kisliuk RL, Gaumont Y, Strumpf D.. (1979) Folate analogues altered in the C9-N10 bridge region: 11-thiohomofolic acid., 22 (7): [PMID:109615 ] [10.1021/jm00193a019 ]