The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
dimethyl N-[4-[[(2,4-Diamino-6-pteridinyl)methyl]-methylamino]phenylcarbamoyl]-L-aspartate ID: ALA3245586
PubChem CID: 90655742
Max Phase: Preclinical
Molecular Formula: C21H25N9O5
Molecular Weight: 483.49
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)C[C@H](NC(=O)Nc1ccc(N(C)Cc2cnc3nc(N)nc(N)c3n2)cc1)C(=O)OC
Standard InChI: InChI=1S/C21H25N9O5/c1-30(10-12-9-24-18-16(25-12)17(22)28-20(23)29-18)13-6-4-11(5-7-13)26-21(33)27-14(19(32)35-3)8-15(31)34-2/h4-7,9,14H,8,10H2,1-3H3,(H2,26,27,33)(H4,22,23,24,28,29)/t14-/m0/s1
Standard InChI Key: UCRGOHIYSDFDLY-AWEZNQCLSA-N
Molfile:
RDKit 2D
35 37 0 0 0 0 0 0 0 0999 V2000
12.4280 -6.7760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9991 -6.7760 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.7135 -7.1885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7135 -8.0135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4280 -8.4260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4280 -9.2510 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.1425 -8.0135 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.4280 -5.9510 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.1425 -7.1885 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.2846 -7.1885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5701 -6.7760 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.2846 -8.0135 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.8557 -7.1885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8557 -8.0135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1412 -8.4260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4267 -8.0135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4267 -7.1885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1412 -6.7760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7122 -8.4260 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.7122 -9.2510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9978 -8.0135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1399 -9.6635 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4254 -9.2510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4254 -8.4260 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.1399 -8.0135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8544 -8.4260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5688 -8.0135 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2833 -8.4260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2833 -9.2510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5688 -9.6635 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8544 -9.2510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1399 -7.1885 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7110 -9.6635 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.8570 -6.7760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8570 -8.4260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3 2 1 6
1 3 1 0
3 4 1 0
4 5 1 0
5 6 2 0
5 7 1 0
1 8 2 0
1 9 1 0
10 11 1 0
10 12 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
13 18 2 0
19 20 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
22 31 2 0
26 31 1 0
25 32 1 0
23 33 1 0
21 28 1 0
19 21 1 0
16 19 1 0
11 13 1 0
2 10 1 0
9 34 1 0
7 35 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 483.49Molecular Weight (Monoisotopic): 483.1979AlogP: 0.45#Rotatable Bonds: 8Polar Surface Area: 200.57Molecular Species: NEUTRALHBA: 12HBD: 4#RO5 Violations: 1HBA (Lipinski): 14HBD (Lipinski): 6#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 3.00CX LogP: 0.05CX LogD: 0.05Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.32Np Likeness Score: -0.96
References 1. Martinelli JE, Chaykovsky M, Kisliuk RL, Gaumont Y, Gittelman MC.. (1979) Methotrexate analogues. 12. Synthesis and biological properties of some aza homologues., 22 (7): [PMID:109616 ] [10.1021/jm00193a022 ]