dimethyl N-[4-[[(2,4-Diamino-6-pteridinyl)methyl]-methylamino]phenylcarbamoyl]-L-glutamate

ID: ALA3245587

PubChem CID: 90655743

Max Phase: Preclinical

Molecular Formula: C22H27N9O5

Molecular Weight: 497.52

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  COC(=O)CC[C@H](NC(=O)Nc1ccc(N(C)Cc2cnc3nc(N)nc(N)c3n2)cc1)C(=O)OC

Standard InChI:  InChI=1S/C22H27N9O5/c1-31(11-13-10-25-19-17(26-13)18(23)29-21(24)30-19)14-6-4-12(5-7-14)27-22(34)28-15(20(33)36-3)8-9-16(32)35-2/h4-7,10,15H,8-9,11H2,1-3H3,(H2,27,28,34)(H4,23,24,25,29,30)/t15-/m0/s1

Standard InChI Key:  YBQKHHZUUFVONP-HNNXBMFYSA-N

Molfile:  

     RDKit          2D

 36 38  0  0  0  0  0  0  0  0999 V2000
   17.5593  -19.0310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1317  -19.0310    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.8476  -19.4435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8476  -20.2685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5593  -20.6810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5593  -21.5060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8476  -21.9185    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.2752  -21.9185    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.5593  -18.2060    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.2752  -19.4435    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.4158  -19.4435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7001  -19.0310    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.4158  -20.2685    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.9884  -19.4435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9884  -20.2685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2725  -20.6810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5608  -20.2685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5608  -19.4435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2725  -19.0310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8450  -20.6810    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.8450  -21.5060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1291  -20.2685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2740  -21.9185    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.5582  -21.5060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5582  -20.6810    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.2740  -20.2685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9857  -20.6810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7015  -20.2685    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.4133  -20.6810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4133  -21.5060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7015  -21.9185    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.9857  -21.5060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2740  -19.4435    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.8423  -21.9185    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.9893  -19.0304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2759  -22.7435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  3  2  1  6
  1  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  6  8  1  0
  1  9  2  0
  1 10  1  0
 11 12  1  0
 11 13  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 14 19  2  0
 20 21  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 23 32  2  0
 27 32  1  0
 26 33  1  0
 24 34  1  0
 22 29  1  0
 20 22  1  0
 17 20  1  0
 12 14  1  0
  2 11  1  0
 10 35  1  0
  8 36  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA3245587

   dimethyl (2S)-2-[[4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]phenyl]carbamoylamino]pentanedioate

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 497.52

Molecular Weight (Monoisotopic): 497.2135

AlogP: 0.84

#Rotatable Bonds: 9

Polar Surface Area: 200.57

Molecular Species: NEUTRAL

HBA: 12

HBD: 4

#RO5 Violations: 1

HBA (Lipinski): 14

HBD (Lipinski): 6

#RO5 Violations (Lipinski): 2

CX Acidic pKa: ┄

CX Basic pKa: 3.00

CX LogP: 0.34

CX LogD: 0.34

Aromatic Rings: 3

Heavy Atoms: 36

QED Weighted: 0.30

Np Likeness Score: -0.91

References

1. Martinelli JE, Chaykovsky M, Kisliuk RL, Gaumont Y, Gittelman MC..  (1979)  Methotrexate analogues. 12. Synthesis and biological properties of some aza homologues.,  22  (7): [PMID:109616] [10.1021/jm00193a022]

Source

Source(1):

• Scientific Literature