The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-[4-[[(2,4-Diamino-6-pteridinyl)methyl]methylamino]phenylcarbamoyl]-DL-glutamicAcid ID: ALA3245589
PubChem CID: 90655745
Max Phase: Preclinical
Molecular Formula: C20H23N9O5
Molecular Weight: 469.46
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN(Cc1cnc2nc(N)nc(N)c2n1)c1ccc(NC(=O)NC(CCC(=O)O)C(=O)O)cc1
Standard InChI: InChI=1S/C20H23N9O5/c1-29(9-11-8-23-17-15(24-11)16(21)27-19(22)28-17)12-4-2-10(3-5-12)25-20(34)26-13(18(32)33)6-7-14(30)31/h2-5,8,13H,6-7,9H2,1H3,(H,30,31)(H,32,33)(H2,25,26,34)(H4,21,22,23,27,28)
Standard InChI Key: DAOJZAXLOKDWKQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
13.8305 -9.2304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4016 -9.2304 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.1160 -9.6429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1160 -10.4679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8305 -10.8804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8305 -11.7054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1160 -12.1179 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.5450 -12.1179 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.8305 -8.4054 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.5450 -9.6429 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.6871 -9.6429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9726 -9.2304 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.6871 -10.4679 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.2582 -9.6429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2582 -10.4679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5437 -10.8804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8292 -10.4679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8292 -9.6429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5437 -9.2304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1147 -10.8804 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.1147 -11.7054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4003 -10.4679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5424 -12.1179 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8279 -11.7054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8279 -10.8804 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.5424 -10.4679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2569 -10.8804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9713 -10.4679 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.6858 -10.8804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6858 -11.7054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9713 -12.1179 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2569 -11.7054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5424 -9.6429 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.1135 -12.1179 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
1 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 2 0
6 8 1 0
1 9 2 0
1 10 1 0
11 12 1 0
11 13 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
14 19 2 0
20 21 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
23 32 2 0
27 32 1 0
26 33 1 0
24 34 1 0
22 29 1 0
20 22 1 0
17 20 1 0
12 14 1 0
2 11 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 469.46Molecular Weight (Monoisotopic): 469.1822AlogP: 0.66#Rotatable Bonds: 9Polar Surface Area: 222.57Molecular Species: ACIDHBA: 10HBD: 6#RO5 Violations: 1HBA (Lipinski): 14HBD (Lipinski): 8#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.39CX Basic pKa: 2.85CX LogP: -0.14CX LogD: -6.44Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.25Np Likeness Score: -0.83
References 1. Martinelli JE, Chaykovsky M, Kisliuk RL, Gaumont Y, Gittelman MC.. (1979) Methotrexate analogues. 12. Synthesis and biological properties of some aza homologues., 22 (7): [PMID:109616 ] [10.1021/jm00193a022 ]