(2R,3S)-5-(2-hydroxy-3-(2-methyl-1-phenylpropan-2-ylamino)propoxy)-1,2,3,4-tetrahydronaphthalene-2,3-diol

ID: ALA3246792

PubChem CID: 90672697

Max Phase: Preclinical

Molecular Formula: C23H31NO4

Molecular Weight: 385.50

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)(Cc1ccccc1)NCC(O)COc1cccc2c1C[C@H](O)[C@H](O)C2

Standard InChI:  InChI=1S/C23H31NO4/c1-23(2,13-16-7-4-3-5-8-16)24-14-18(25)15-28-22-10-6-9-17-11-20(26)21(27)12-19(17)22/h3-10,18,20-21,24-27H,11-15H2,1-2H3/t18?,20-,21+/m1/s1

Standard InChI Key:  RYTCXIJCVJZNHZ-HBYOEVMUSA-N

Molfile:  

     RDKit          2D

 28 30  0  0  0  0  0  0  0  0999 V2000
    4.4061  -21.8498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1172  -22.2550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1211  -23.0698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4160  -23.4830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7071  -23.0813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0020  -23.4945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2910  -23.0893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2850  -22.2709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9901  -21.8578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7011  -22.2630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4002  -21.0314    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1049  -20.6177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8155  -21.0211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5202  -20.6073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8215  -21.8382    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2309  -21.0107    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.5859  -23.5025    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5745  -21.8672    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.9356  -20.5970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6463  -21.0004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5198  -19.8850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3370  -19.8850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3510  -20.5866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0619  -20.9918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7661  -20.5787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7606  -19.7607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0449  -19.3575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3436  -19.7729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  1 10  2  0
  5 10  1  0
  1 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 13 15  1  0
 14 16  1  0
  7 17  1  1
  8 18  1  1
 16 19  1  0
 19 20  1  0
 19 21  1  0
 19 22  1  0
 20 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
M  END

Associated Targets(non-human)

Adrb1 Adrenergic receptor beta (703 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 385.50Molecular Weight (Monoisotopic): 385.2253AlogP: 1.86#Rotatable Bonds: 8
Polar Surface Area: 81.95Molecular Species: BASEHBA: 5HBD: 4
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 13.59CX Basic pKa: 9.53CX LogP: 2.52CX LogD: 0.42
Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.56Np Likeness Score: 0.17

References

1. Condon ME, Cimarusti CM, Fox R, Narayanan VL, Reid J, Sundeen JE, Hauck FP..  (1978)  Nondepressant beta-adrenergic blocking agents. 1. Substituted 3-amino-1-(5,6,7,8-tetrahydro-1-naphthoxy)-2-propanols.,  21  (9): [PMID:31485] [10.1021/jm00207a014]

Source