(2R,3S)-5-(3-(2-(4-allyl-2-methoxyphenoxy)ethylamino)-2-hydroxypropoxy)-1,2,3,4-tetrahydronaphthalene-2,3-diol

ID: ALA3246795

PubChem CID: 90672700

Max Phase: Preclinical

Molecular Formula: C25H33NO6

Molecular Weight: 443.54

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=CCc1ccc(OCCNCC(O)COc2cccc3c2C[C@H](O)[C@H](O)C3)c(OC)c1

Standard InChI:  InChI=1S/C25H33NO6/c1-3-5-17-8-9-24(25(12-17)30-2)31-11-10-26-15-19(27)16-32-23-7-4-6-18-13-21(28)22(29)14-20(18)23/h3-4,6-9,12,19,21-22,26-29H,1,5,10-11,13-16H2,2H3/t19?,21-,22+/m1/s1

Standard InChI Key:  GIFANPXODYBPCX-WXPBMIAQSA-N

Molfile:  

     RDKit          2D

 32 34  0  0  0  0  0  0  0  0999 V2000
   18.5749   -5.1180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2860   -5.5232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2898   -6.3380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5848   -6.7512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8758   -6.3495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1708   -6.7627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4598   -6.3575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4538   -5.5391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1588   -5.1260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8699   -5.5312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5689   -4.2996    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.2736   -3.8859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9843   -4.2893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6890   -3.8755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9903   -5.1065    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.3997   -4.2789    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.7547   -6.7707    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.7433   -5.1354    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.1044   -3.8652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8151   -4.2686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5198   -3.8548    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.2304   -4.2582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2342   -5.0734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9440   -5.4768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6497   -5.0629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6411   -4.2416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9307   -3.8419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9209   -3.0248    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.6236   -2.6078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3609   -5.4654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0651   -5.0507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7763   -5.4532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  1 10  2  0
  5 10  1  0
  1 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 13 15  1  0
 14 16  1  0
  7 17  1  1
  8 18  1  1
 16 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 27 28  1  0
 28 29  1  0
 25 30  1  0
 30 31  1  0
 31 32  2  0
M  END

Associated Targets(non-human)

Adrb1 Adrenergic receptor beta (703 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 443.54Molecular Weight (Monoisotopic): 443.2308AlogP: 1.65#Rotatable Bonds: 12
Polar Surface Area: 100.41Molecular Species: BASEHBA: 7HBD: 4
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 13.59CX Basic pKa: 8.74CX LogP: 2.40CX LogD: 1.04
Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.29Np Likeness Score: 0.31

References

1. Condon ME, Cimarusti CM, Fox R, Narayanan VL, Reid J, Sundeen JE, Hauck FP..  (1978)  Nondepressant beta-adrenergic blocking agents. 1. Substituted 3-amino-1-(5,6,7,8-tetrahydro-1-naphthoxy)-2-propanols.,  21  (9): [PMID:31485] [10.1021/jm00207a014]

Source