The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2R,3S)-5-(3-(2-(4-allyl-2-methoxyphenoxy)ethylamino)-2-hydroxypropoxy)-1,2,3,4-tetrahydronaphthalene-2,3-diol ID: ALA3246795
PubChem CID: 90672700
Max Phase: Preclinical
Molecular Formula: C25H33NO6
Molecular Weight: 443.54
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=CCc1ccc(OCCNCC(O)COc2cccc3c2C[C@H](O)[C@H](O)C3)c(OC)c1
Standard InChI: InChI=1S/C25H33NO6/c1-3-5-17-8-9-24(25(12-17)30-2)31-11-10-26-15-19(27)16-32-23-7-4-6-18-13-21(28)22(29)14-20(18)23/h3-4,6-9,12,19,21-22,26-29H,1,5,10-11,13-16H2,2H3/t19?,21-,22+/m1/s1
Standard InChI Key: GIFANPXODYBPCX-WXPBMIAQSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
18.5749 -5.1180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2860 -5.5232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2898 -6.3380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5848 -6.7512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8758 -6.3495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1708 -6.7627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4598 -6.3575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4538 -5.5391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1588 -5.1260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8699 -5.5312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5689 -4.2996 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.2736 -3.8859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9843 -4.2893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6890 -3.8755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9903 -5.1065 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.3997 -4.2789 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.7547 -6.7707 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.7433 -5.1354 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.1044 -3.8652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8151 -4.2686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5198 -3.8548 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.2304 -4.2582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2342 -5.0734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9440 -5.4768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6497 -5.0629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6411 -4.2416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9307 -3.8419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9209 -3.0248 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.6236 -2.6078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3609 -5.4654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0651 -5.0507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7763 -5.4532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
1 10 2 0
5 10 1 0
1 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
13 15 1 0
14 16 1 0
7 17 1 1
8 18 1 1
16 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
27 28 1 0
28 29 1 0
25 30 1 0
30 31 1 0
31 32 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 443.54Molecular Weight (Monoisotopic): 443.2308AlogP: 1.65#Rotatable Bonds: 12Polar Surface Area: 100.41Molecular Species: BASEHBA: 7HBD: 4#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.59CX Basic pKa: 8.74CX LogP: 2.40CX LogD: 1.04Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.29Np Likeness Score: 0.31
References 1. Condon ME, Cimarusti CM, Fox R, Narayanan VL, Reid J, Sundeen JE, Hauck FP.. (1978) Nondepressant beta-adrenergic blocking agents. 1. Substituted 3-amino-1-(5,6,7,8-tetrahydro-1-naphthoxy)-2-propanols., 21 (9): [PMID:31485 ] [10.1021/jm00207a014 ]