(2R,3S)-5-(3-(2-(benzyl(tert-butyl)amino)ethylamino)-2-hydroxypropoxy)-1,2,3,4-tetrahydronaphthalene-2,3-diol

ID: ALA3246800

PubChem CID: 90672705

Max Phase: Preclinical

Molecular Formula: C26H38N2O4

Molecular Weight: 442.60

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)(C)N(CCNCC(O)COc1cccc2c1C[C@H](O)[C@H](O)C2)Cc1ccccc1

Standard InChI:  InChI=1S/C26H38N2O4/c1-26(2,3)28(17-19-8-5-4-6-9-19)13-12-27-16-21(29)18-32-25-11-7-10-20-14-23(30)24(31)15-22(20)25/h4-11,21,23-24,27,29-31H,12-18H2,1-3H3/t21?,23-,24+/m1/s1

Standard InChI Key:  QWJRBHDAYAKKSG-RSOKHERMSA-N

Molfile:  

     RDKit          2D

 32 34  0  0  0  0  0  0  0  0999 V2000
    8.9548   -5.8671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4114   -7.1247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3795   -5.8567    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.9608   -6.6879    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8327   -7.1166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2540   -7.1086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7983   -5.8462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5503   -8.3399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7057   -8.3596    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6942   -6.7172    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1311   -8.3516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6620   -5.4536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2416   -5.4640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2579   -7.9270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5403   -6.6996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4175   -7.9467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0846   -5.4386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5342   -5.8776    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8388   -7.9386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1191   -6.7076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5041   -5.4342    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.2137   -5.8394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9195   -5.4275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6273   -5.8377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3326   -5.4264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3292   -4.6083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6145   -4.2033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9122   -4.6169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5002   -4.6170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2059   -4.2051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7905   -4.2118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4931   -3.7971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 14  8  1  0
  1 12  1  0
 20  5  1  0
  8 19  2  0
  1  4  1  0
 16  2  1  0
 16  9  1  1
 12  3  1  0
 15  6  1  0
  2 10  1  1
 15  5  2  0
  6 14  2  0
 11 16  1  0
 15 18  1  0
 19  5  1  0
 18 13  1  0
 13  1  1  0
  7 17  1  0
  2 20  1  0
  3 17  1  0
 19 11  1  0
  7 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 21 29  1  0
 29 30  1  0
 29 31  1  0
 29 32  1  0
M  END

Associated Targets(non-human)

Adrb1 Adrenergic receptor beta (703 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 442.60Molecular Weight (Monoisotopic): 442.2832AlogP: 2.14#Rotatable Bonds: 10
Polar Surface Area: 85.19Molecular Species: BASEHBA: 6HBD: 4
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 13.59CX Basic pKa: 9.34CX LogP: 2.61CX LogD: 0.68
Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.42Np Likeness Score: -0.11

References

1. Condon ME, Cimarusti CM, Fox R, Narayanan VL, Reid J, Sundeen JE, Hauck FP..  (1978)  Nondepressant beta-adrenergic blocking agents. 1. Substituted 3-amino-1-(5,6,7,8-tetrahydro-1-naphthoxy)-2-propanols.,  21  (9): [PMID:31485] [10.1021/jm00207a014]

Source