The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2R,3S)-5-(2-hydroxy-3-(4-(2-methoxyphenyl)piperazin-1-yl)propoxy)-1,2,3,4-tetrahydronaphthalene-2,3-diol ID: ALA3246801
PubChem CID: 90672706
Max Phase: Preclinical
Molecular Formula: C24H32N2O5
Molecular Weight: 428.53
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccccc1N1CCN(CC(O)COc2cccc3c2C[C@H](O)[C@H](O)C3)CC1
Standard InChI: InChI=1S/C24H32N2O5/c1-30-24-7-3-2-6-20(24)26-11-9-25(10-12-26)15-18(27)16-31-23-8-4-5-17-13-21(28)22(29)14-19(17)23/h2-8,18,21-22,27-29H,9-16H2,1H3/t18?,21-,22+/m1/s1
Standard InChI Key: NOSMPFYHVFUEAM-YPFKAFGZSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
12.0318 -11.7712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3289 -12.9953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3230 -12.1809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7457 -12.1777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7460 -12.9972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0384 -13.4086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4712 -10.5543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8913 -10.5393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0615 -13.0324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9282 -13.4558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1895 -11.7759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6099 -11.7688 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3389 -11.8006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3329 -10.9772 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.1854 -10.9561 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.6057 -10.9456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5053 -13.4640 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4938 -11.8184 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2137 -13.0523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2076 -12.2288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9161 -11.8088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0575 -12.2125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3490 -13.4442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6366 -13.0442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6306 -12.2207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7692 -11.7889 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.0450 -10.5647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7632 -10.9666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8993 -12.1859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0291 -10.9540 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.7355 -10.5431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6 5 1 0
2 6 2 0
4 1 1 0
1 3 2 0
3 2 1 0
5 4 2 0
19 20 1 0
10 19 1 0
13 14 1 0
13 25 2 0
23 24 2 0
15 11 1 0
9 23 1 0
13 22 1 0
12 3 1 0
19 17 1 1
20 18 1 1
7 15 1 0
29 12 1 0
24 25 1 0
24 10 1 0
11 29 1 0
22 9 2 0
12 16 1 0
20 21 1 0
28 26 1 0
15 8 1 0
21 25 1 0
27 28 1 0
14 27 1 0
16 8 1 0
28 7 1 0
1 30 1 0
30 31 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 428.53Molecular Weight (Monoisotopic): 428.2311AlogP: 1.08#Rotatable Bonds: 7Polar Surface Area: 85.63Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.58CX Basic pKa: 7.27CX LogP: 1.78CX LogD: 1.54Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.61Np Likeness Score: -0.46
References 1. Condon ME, Cimarusti CM, Fox R, Narayanan VL, Reid J, Sundeen JE, Hauck FP.. (1978) Nondepressant beta-adrenergic blocking agents. 1. Substituted 3-amino-1-(5,6,7,8-tetrahydro-1-naphthoxy)-2-propanols., 21 (9): [PMID:31485 ] [10.1021/jm00207a014 ]