(2R,3S)-5-(2-hydroxy-3-(4-(2-methoxyphenyl)piperazin-1-yl)propoxy)-1,2,3,4-tetrahydronaphthalene-2,3-diol

ID: ALA3246801

PubChem CID: 90672706

Max Phase: Preclinical

Molecular Formula: C24H32N2O5

Molecular Weight: 428.53

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccccc1N1CCN(CC(O)COc2cccc3c2C[C@H](O)[C@H](O)C3)CC1

Standard InChI:  InChI=1S/C24H32N2O5/c1-30-24-7-3-2-6-20(24)26-11-9-25(10-12-26)15-18(27)16-31-23-8-4-5-17-13-21(28)22(29)14-19(17)23/h2-8,18,21-22,27-29H,9-16H2,1H3/t18?,21-,22+/m1/s1

Standard InChI Key:  NOSMPFYHVFUEAM-YPFKAFGZSA-N

Molfile:  

     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   12.0318  -11.7712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3289  -12.9953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3230  -12.1809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7457  -12.1777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7460  -12.9972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0384  -13.4086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4712  -10.5543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8913  -10.5393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0615  -13.0324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9282  -13.4558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1895  -11.7759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6099  -11.7688    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.3389  -11.8006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3329  -10.9772    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.1854  -10.9561    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.6057  -10.9456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5053  -13.4640    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4938  -11.8184    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2137  -13.0523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2076  -12.2288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9161  -11.8088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0575  -12.2125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3490  -13.4442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6366  -13.0442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6306  -12.2207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7692  -11.7889    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.0450  -10.5647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7632  -10.9666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8993  -12.1859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0291  -10.9540    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.7355  -10.5431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  6  5  1  0
  2  6  2  0
  4  1  1  0
  1  3  2  0
  3  2  1  0
  5  4  2  0
 19 20  1  0
 10 19  1  0
 13 14  1  0
 13 25  2  0
 23 24  2  0
 15 11  1  0
  9 23  1  0
 13 22  1  0
 12  3  1  0
 19 17  1  1
 20 18  1  1
  7 15  1  0
 29 12  1  0
 24 25  1  0
 24 10  1  0
 11 29  1  0
 22  9  2  0
 12 16  1  0
 20 21  1  0
 28 26  1  0
 15  8  1  0
 21 25  1  0
 27 28  1  0
 14 27  1  0
 16  8  1  0
 28  7  1  0
  1 30  1  0
 30 31  1  0
M  END

Associated Targets(non-human)

Adrb1 Adrenergic receptor beta (703 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 428.53Molecular Weight (Monoisotopic): 428.2311AlogP: 1.08#Rotatable Bonds: 7
Polar Surface Area: 85.63Molecular Species: NEUTRALHBA: 7HBD: 3
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 13.58CX Basic pKa: 7.27CX LogP: 1.78CX LogD: 1.54
Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.61Np Likeness Score: -0.46

References

1. Condon ME, Cimarusti CM, Fox R, Narayanan VL, Reid J, Sundeen JE, Hauck FP..  (1978)  Nondepressant beta-adrenergic blocking agents. 1. Substituted 3-amino-1-(5,6,7,8-tetrahydro-1-naphthoxy)-2-propanols.,  21  (9): [PMID:31485] [10.1021/jm00207a014]

Source