4-(bis(2-chloroethyl)amino)phenyl 4-methoxybenzoate

ID: ALA3246953

Cas Number: 22953-57-7

PubChem CID: 89928

Max Phase: Preclinical

Molecular Formula: C18H19Cl2NO3

Molecular Weight: 368.26

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(C(=O)Oc2ccc(N(CCCl)CCCl)cc2)cc1

Standard InChI:  InChI=1S/C18H19Cl2NO3/c1-23-16-6-2-14(3-7-16)18(22)24-17-8-4-15(5-9-17)21(12-10-19)13-11-20/h2-9H,10-13H2,1H3

Standard InChI Key:  HYSSJKYEXPISGA-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 24 25  0  0  0  0  0  0  0  0999 V2000
   13.5978  -15.4069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5967  -16.2264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3047  -16.6354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0144  -16.2260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0115  -15.4033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3029  -14.9980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3045  -17.4526    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.5967  -17.8610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0121  -17.8614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0119  -18.6786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5965  -18.6782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8887  -19.0866    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   15.7195  -19.0873    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   14.3005  -14.1809    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.0070  -13.7702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0045  -12.9530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7159  -14.1766    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.7129  -12.5467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7108  -11.7303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0013  -11.3230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2925  -11.7381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2981  -12.5532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9978  -10.5058    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.7037  -10.0942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  3  7  1  0
  7  8  1  0
  7  9  1  0
  9 10  1  0
  8 11  1  0
 11 12  1  0
 10 13  1  0
  6 14  1  0
 14 15  1  0
 15 16  1  0
 15 17  2  0
 16 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 16  1  0
 20 23  1  0
 23 24  1  0
M  END

Alternative Forms

Associated Targets(non-human)

W256 (236 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Rattus norvegicus (775804 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 368.26Molecular Weight (Monoisotopic): 367.0742AlogP: 4.20#Rotatable Bonds: 8
Polar Surface Area: 38.77Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 1.38CX LogP: 4.91CX LogD: 4.91
Aromatic Rings: 2Heavy Atoms: 24QED Weighted: 0.40Np Likeness Score: -0.59

References

1. Panthananickal A, Hansch C, Leo A..  (1978)  Structure-activity relationships in antitumor aniline mustards.,  21  (1): [PMID:619146] [10.1021/jm00199a004]

Source