The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
O-butyl S-1-(2,4-dichlorophenyl)-2-(1H-imidazol-1-yl)ethyl carbonodithioate nitrate ID: ALA3247044
PubChem CID: 12460793
Max Phase: Preclinical
Molecular Formula: C16H19Cl2N3O4S2
Molecular Weight: 389.37
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCCOC(=S)SC(Cn1ccnc1)c1ccc(Cl)cc1Cl.O=[N+]([O-])O
Standard InChI: InChI=1S/C16H18Cl2N2OS2.HNO3/c1-2-3-8-21-16(22)23-15(10-20-7-6-19-11-20)13-5-4-12(17)9-14(13)18;2-1(3)4/h4-7,9,11,15H,2-3,8,10H2,1H3;(H,2,3,4)
Standard InChI Key: PTPOADGWNZNSET-UHFFFAOYSA-N
Molfile:
RDKit 2D
27 27 0 0 0 0 0 0 0 0999 V2000
39.3348 -10.3714 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.6204 -10.7839 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.3348 -9.5464 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.0493 -10.7839 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.8208 -10.0973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8197 -10.9246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5345 -11.3375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2509 -10.9242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2481 -10.0936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5327 -9.6845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9660 -11.3355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9673 -12.1605 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
35.6799 -10.9219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6786 -10.0969 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.3435 -9.6127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0874 -8.8285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2623 -8.8298 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.0087 -9.6148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6824 -12.5719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6837 -13.3969 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
36.3963 -12.1583 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.1114 -12.5697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5322 -12.1607 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
32.1045 -9.6900 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
37.8252 -12.1561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5403 -12.5674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2541 -12.1538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 2 0
1 4 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
8 11 1 0
11 12 1 0
11 13 1 0
13 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 14 1 0
12 19 1 0
19 20 2 0
19 21 1 0
21 22 1 0
7 23 1 0
5 24 1 0
22 25 1 0
25 26 1 0
26 27 1 0
M CHG 2 1 1 4 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 389.37Molecular Weight (Monoisotopic): 388.0238AlogP: 5.77#Rotatable Bonds: 7Polar Surface Area: 27.05Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 6.50CX LogP: 6.12CX LogD: 6.09Aromatic Rings: 2Heavy Atoms: 23QED Weighted: 0.44Np Likeness Score: -1.20
References 1. Walker KA, Hirschfeld DR, Marx M.. (1978) Antimycotic imidazoles. 2. Synthesis and antifungal properties of esters of 1-[2-hydroxy(mercapto)-2-phenylethyl]-1H-imidazoles., 21 (12): [PMID:722748 ] [10.1021/jm00210a037 ]