The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
O-benzyl S-1-(2,4-dichlorophenyl)-2-(1H-imidazol-1-yl)ethyl carbonodithioate oxalate ID: ALA3247049
PubChem CID: 12460803
Max Phase: Preclinical
Molecular Formula: C21H18Cl2N2O5S2
Molecular Weight: 423.39
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)C(=O)O.S=C(OCc1ccccc1)SC(Cn1ccnc1)c1ccc(Cl)cc1Cl
Standard InChI: InChI=1S/C19H16Cl2N2OS2.C2H2O4/c20-15-6-7-16(17(21)10-15)18(11-23-9-8-22-13-23)26-19(25)24-12-14-4-2-1-3-5-14;3-1(4)2(5)6/h1-10,13,18H,11-12H2;(H,3,4)(H,5,6)
Standard InChI Key: DUSHHSTXGFYMHS-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 33 0 0 0 0 0 0 0 0999 V2000
32.6206 -9.3991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9062 -9.8116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6206 -8.5741 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.3351 -9.8116 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.9062 -10.6366 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.1917 -9.3991 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.0496 -10.2720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0484 -11.0993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7632 -11.5122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4797 -11.0989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4768 -10.2683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7614 -9.8592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1948 -11.5102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1961 -12.3352 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
27.9086 -11.0966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9073 -10.2716 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.5723 -9.7874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3161 -9.0032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4911 -9.0045 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.2375 -9.7895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9112 -12.7466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9125 -13.5716 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
28.6250 -12.3330 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.3402 -12.7444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7609 -12.3355 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
24.3333 -9.8647 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
30.0540 -12.3308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7689 -12.7438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4822 -12.3309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4814 -11.5050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7612 -11.0938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0508 -11.5091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 2 0
1 4 1 0
2 5 2 0
2 6 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
10 13 1 0
13 14 1 0
13 15 1 0
15 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 16 1 0
14 21 1 0
21 22 2 0
21 23 1 0
23 24 1 0
9 25 1 0
7 26 1 0
24 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 423.39Molecular Weight (Monoisotopic): 422.0081AlogP: 6.17#Rotatable Bonds: 6Polar Surface Area: 27.05Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 6.50CX LogP: 6.52CX LogD: 6.49Aromatic Rings: 3Heavy Atoms: 26QED Weighted: 0.44Np Likeness Score: -1.20
References 1. Walker KA, Hirschfeld DR, Marx M.. (1978) Antimycotic imidazoles. 2. Synthesis and antifungal properties of esters of 1-[2-hydroxy(mercapto)-2-phenylethyl]-1H-imidazoles., 21 (12): [PMID:722748 ] [10.1021/jm00210a037 ]