The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
S-1-(4-chlorophenyl)-2-(1H-imidazol-1-yl)ethyl O-pentyl carbonodithioate oxalate ID: ALA3247050
PubChem CID: 12460805
Max Phase: Preclinical
Molecular Formula: C19H23ClN2O5S2
Molecular Weight: 368.96
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCOC(=S)SC(Cn1ccnc1)c1ccc(Cl)cc1.O=C(O)C(=O)O
Standard InChI: InChI=1S/C17H21ClN2OS2.C2H2O4/c1-2-3-4-11-21-17(22)23-16(12-20-10-9-19-13-20)14-5-7-15(18)8-6-14;3-1(4)2(5)6/h5-10,13,16H,2-4,11-12H2,1H3;(H,3,4)(H,5,6)
Standard InChI Key: KLIBEYMGNIRYGV-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 29 0 0 0 0 0 0 0 0999 V2000
42.4617 -10.4598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.7472 -10.8723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.4617 -9.6348 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.1762 -10.8723 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.7472 -11.6973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.0328 -10.4598 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.2871 -10.5095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2859 -11.3368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0007 -11.7497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7172 -11.3364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7143 -10.5058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9989 -10.0967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4323 -11.7477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4336 -12.5727 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
38.1461 -11.3341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1448 -10.5091 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.8098 -10.0249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5536 -9.2407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7286 -9.2420 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.4750 -10.0270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1487 -12.9841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1500 -13.8091 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
38.8625 -12.5705 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.5777 -12.9819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5708 -10.1022 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
40.2915 -12.5683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.0066 -12.9796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.7204 -12.5660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.4355 -12.9774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 2 0
1 4 1 0
2 5 2 0
2 6 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
10 13 1 0
13 14 1 0
13 15 1 0
15 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 16 1 0
14 21 1 0
21 22 2 0
21 23 1 0
23 24 1 0
7 25 1 0
24 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 368.96Molecular Weight (Monoisotopic): 368.0784AlogP: 5.50#Rotatable Bonds: 8Polar Surface Area: 27.05Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 6.50CX LogP: 5.96CX LogD: 5.93Aromatic Rings: 2Heavy Atoms: 23QED Weighted: 0.45Np Likeness Score: -1.06
References 1. Walker KA, Hirschfeld DR, Marx M.. (1978) Antimycotic imidazoles. 2. Synthesis and antifungal properties of esters of 1-[2-hydroxy(mercapto)-2-phenylethyl]-1H-imidazoles., 21 (12): [PMID:722748 ] [10.1021/jm00210a037 ]