ethyl(1-adamantylamino)carbonothioylcarbamate

ID: ALA3247963

PubChem CID: 2728763

Max Phase: Preclinical

Molecular Formula: C14H22N2O2S

Molecular Weight: 282.41

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOC(=O)NC(=S)NC12CC3CC(CC(C3)C1)C2

Standard InChI:  InChI=1S/C14H22N2O2S/c1-2-18-13(17)15-12(19)16-14-6-9-3-10(7-14)5-11(4-9)8-14/h9-11H,2-8H2,1H3,(H2,15,16,17,19)

Standard InChI Key:  DFUZNDJMFAJHKC-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 19 21  0  0  0  0  0  0  0  0999 V2000
    6.3056   -3.9418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9468   -3.2581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1101   -3.7168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6583   -3.5208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8627   -4.0195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4061   -3.3352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1073   -2.8684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6639   -2.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9424   -2.4626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4119   -2.5163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1172   -3.7460    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.8318   -3.3337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5462   -3.7463    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.8320   -2.5087    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   11.2608   -3.3340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9752   -3.7468    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.2610   -2.5090    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.6898   -3.3344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4041   -3.7471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  1  0
  2  4  1  0
  3  5  1  0
  4  6  1  0
  5  6  1  0
  7  8  1  0
  3  7  1  0
  2  9  1  0
  6 10  1  0
 10  8  1  0
  8  9  1  0
  6 11  1  0
 11 12  1  0
 12 13  1  0
 12 14  2  0
 13 15  1  0
 15 16  1  0
 15 17  2  0
 16 18  1  0
 18 19  1  0
M  END

Alternative Forms

Associated Targets(non-human)

unidentified influenza virus (265 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 282.41Molecular Weight (Monoisotopic): 282.1402AlogP: 2.58#Rotatable Bonds: 2
Polar Surface Area: 50.36Molecular Species: NEUTRALHBA: 3HBD: 2
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 8.61CX Basic pKa: CX LogP: 2.81CX LogD: 2.78
Aromatic Rings: Heavy Atoms: 19QED Weighted: 0.76Np Likeness Score: -0.99

References

1. Tilley JW, Levitan P, Kramer MJ..  (1979)  Adamantylthiourea derivatives as antiviral agents.,  22  (8): [PMID:490532] [10.1021/jm00194a025]

Source