phenyl(1-adamantylamino)carbonothioylcarbamate

ID: ALA3247964

PubChem CID: 3007728

Max Phase: Preclinical

Molecular Formula: C18H22N2O2S

Molecular Weight: 330.45

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(NC(=S)NC12CC3CC(CC(C3)C1)C2)Oc1ccccc1

Standard InChI:  InChI=1S/C18H22N2O2S/c21-17(22-15-4-2-1-3-5-15)19-16(23)20-18-9-12-6-13(10-18)8-14(7-12)11-18/h1-5,12-14H,6-11H2,(H2,19,20,21,23)

Standard InChI Key:  WBXNJYFKHKHSQN-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 23 26  0  0  0  0  0  0  0  0999 V2000
   13.6603   -4.9590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3022   -4.2746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4655   -4.7337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0142   -4.5376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2189   -5.0368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7628   -4.3518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4628   -3.8845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0200   -3.2218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2977   -3.4784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7687   -3.5322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4745   -4.7630    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.1898   -4.3503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9049   -4.7633    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.1900   -3.5245    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   18.6201   -4.3506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3352   -4.7637    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.6203   -3.5248    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.0505   -4.3510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7635   -4.7680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4783   -4.3560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4790   -3.5292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7588   -3.1163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0470   -3.5307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  1  0
  2  4  1  0
  3  5  1  0
  4  6  1  0
  5  6  1  0
  7  8  1  0
  3  7  1  0
  2  9  1  0
  6 10  1  0
 10  8  1  0
  8  9  1  0
  6 11  1  0
 11 12  1  0
 12 13  1  0
 12 14  2  0
 13 15  1  0
 15 16  1  0
 15 17  2  0
 16 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
M  END

Alternative Forms

Associated Targets(non-human)

unidentified influenza virus (265 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 330.45Molecular Weight (Monoisotopic): 330.1402AlogP: 3.62#Rotatable Bonds: 2
Polar Surface Area: 50.36Molecular Species: NEUTRALHBA: 3HBD: 2
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 8.49CX Basic pKa: CX LogP: 4.11CX LogD: 4.07
Aromatic Rings: 1Heavy Atoms: 23QED Weighted: 0.81Np Likeness Score: -0.88

References

1. Tilley JW, Levitan P, Kramer MJ..  (1979)  Adamantylthiourea derivatives as antiviral agents.,  22  (8): [PMID:490532] [10.1021/jm00194a025]

Source