diethyl(1-adamantylamino)carbonothioylamidophosphate

ID: ALA3247965

Cas Number: 56252-47-2

PubChem CID: 3007729

Max Phase: Preclinical

Molecular Formula: C15H27N2O3PS

Molecular Weight: 346.43

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOP(=O)(NC(=S)NC12CC3CC(CC(C3)C1)C2)OCC

Standard InChI:  InChI=1S/C15H27N2O3PS/c1-3-19-21(18,20-4-2)17-14(22)16-15-8-11-5-12(9-15)7-13(6-11)10-15/h11-13H,3-10H2,1-2H3,(H2,16,17,18,22)

Standard InChI Key:  CVAVUZNNEOGGDW-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 22 24  0  0  0  0  0  0  0  0999 V2000
   29.1025   -4.5215    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   29.5152   -3.8071    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.6902   -3.8069    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.1474   -5.1293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7887   -4.4456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9519   -4.9041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5000   -4.7082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7046   -5.2069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2479   -4.5227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9492   -4.0558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5058   -3.3937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7842   -3.6501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2538   -3.7037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9590   -4.9334    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.6736   -4.5211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3879   -4.9338    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.6738   -3.6961    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   29.8169   -4.9341    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.1028   -3.0925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6905   -2.3779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3403   -3.8073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7526   -4.5219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  1  3  1  0
  4  5  1  0
  4  6  1  0
  5  7  1  0
  6  8  1  0
  7  9  1  0
  8  9  1  0
 10 11  1  0
  6 10  1  0
  5 12  1  0
  9 13  1  0
 13 11  1  0
 11 12  1  0
  9 14  1  0
 14 15  1  0
 15 16  1  0
 15 17  2  0
 16  1  1  0
  1 18  2  0
  3 19  1  0
 19 20  1  0
  2 21  1  0
 21 22  1  0
M  END

Alternative Forms

Associated Targets(non-human)

unidentified influenza virus (265 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 346.43Molecular Weight (Monoisotopic): 346.1480AlogP: 3.60#Rotatable Bonds: 6
Polar Surface Area: 59.59Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 7.89CX Basic pKa: CX LogP: 2.73CX LogD: 2.63
Aromatic Rings: Heavy Atoms: 22QED Weighted: 0.57Np Likeness Score: -0.57

References

1. Tilley JW, Levitan P, Kramer MJ..  (1979)  Adamantylthiourea derivatives as antiviral agents.,  22  (8): [PMID:490532] [10.1021/jm00194a025]

Source