1-Adamantyl-3-carbethoxy-2-methylisothiourea

ID: ALA3247970

PubChem CID: 90673076

Max Phase: Preclinical

Molecular Formula: C15H24N2O2S

Molecular Weight: 296.44

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOC(=O)/N=C(/NC12CC3CC(CC(C3)C1)C2)SC

Standard InChI:  InChI=1S/C15H24N2O2S/c1-3-19-14(18)16-13(20-2)17-15-7-10-4-11(8-15)6-12(5-10)9-15/h10-12H,3-9H2,1-2H3,(H,16,17,18)

Standard InChI Key:  OTHSEVNSABVRAK-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 20 22  0  0  0  0  0  0  0  0999 V2000
    7.4072  -12.4797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4027  -11.6842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4353  -12.9683    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5704  -12.9383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7209  -12.5556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5773  -12.9676    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.8664  -12.5568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7211  -11.7306    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.2919  -12.5552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5677  -12.0900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7660  -13.1633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1243  -11.4279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0062  -12.9679    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.3231  -13.2411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8642  -12.9686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1185  -12.7423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8722  -11.7379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1498  -12.5559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2921  -11.7380    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    9.5845  -11.3292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 13  5  1  0
  4 10  1  0
  4 14  1  0
  1  2  1  0
  7 17  1  0
 17 12  1  0
 10 12  1  0
  5  3  1  0
  6  9  1  0
 16  7  1  0
  5  8  2  0
 14  7  1  0
 18 15  1  0
 11  4  1  0
  9 13  2  0
  3 18  1  0
 11  1  1  0
 12  2  1  0
  1 16  1  0
  7  6  1  0
  9 19  1  0
 19 20  1  0
M  END

Associated Targets(non-human)

unidentified influenza virus (265 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 296.44Molecular Weight (Monoisotopic): 296.1558AlogP: 3.42#Rotatable Bonds: 2
Polar Surface Area: 50.69Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.30CX LogD: 3.30
Aromatic Rings: Heavy Atoms: 20QED Weighted: 0.63Np Likeness Score: -0.74

References

1. Tilley JW, Levitan P, Kramer MJ..  (1979)  Adamantylthiourea derivatives as antiviral agents.,  22  (8): [PMID:490532] [10.1021/jm00194a025]

Source