The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N4-(2-(3,4-dichlorophenyl)-6-methoxy-4H-thiochromen-4-ylidene)-N1,N1-diethylpentane-1,4-diamine dihydrochloride ID: ALA3249015
PubChem CID: 90673560
Max Phase: Preclinical
Molecular Formula: C25H31Cl3N2OS
Molecular Weight: 477.50
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCN(CC)CCCC(C)/N=c1\cc(-c2ccc(Cl)c(Cl)c2)sc2ccc(OC)cc12.Cl
Standard InChI: InChI=1S/C25H30Cl2N2OS.ClH/c1-5-29(6-2)13-7-8-17(3)28-23-16-25(18-9-11-21(26)22(27)14-18)31-24-12-10-19(30-4)15-20(23)24;/h9-12,14-17H,5-8,13H2,1-4H3;1H/b28-23+;
Standard InChI Key: WQDCXSZPUMNONV-XVBNZNTOSA-N
Molfile:
RDKit 2D
32 33 0 0 0 0 0 0 0 0999 V2000
20.9129 -30.6153 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
12.4917 -28.7461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4906 -29.5656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1986 -29.9746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1968 -28.3372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9054 -28.7425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9062 -29.5615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6147 -29.9686 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
15.3230 -29.5578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3183 -28.7356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6091 -28.3323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6048 -27.5151 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.0287 -29.9595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0306 -30.7778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7390 -31.1836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4461 -30.7722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4403 -29.9508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7313 -29.5487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3103 -27.1028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0202 -27.5076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7257 -27.0952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3060 -26.2856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4356 -27.5001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1411 -27.0877 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.8510 -27.4926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1368 -26.2706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8423 -25.8582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5565 -27.0802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7908 -28.3377 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.1560 -31.1771 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
18.1450 -29.5370 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
11.7941 -27.5205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 7 2 0
6 5 2 0
5 2 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 6 1 0
11 12 2 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
9 13 1 0
12 19 1 0
19 20 1 0
20 21 1 0
19 22 1 0
21 23 1 0
23 24 1 0
24 25 1 0
24 26 1 0
26 27 1 0
25 28 1 0
2 29 1 0
16 30 1 0
17 31 1 0
29 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 477.50Molecular Weight (Monoisotopic): 476.1456AlogP: 7.29#Rotatable Bonds: 9Polar Surface Area: 24.83Molecular Species: BASEHBA: 4HBD: ┄#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 10.32CX LogP: 6.45CX LogD: 3.63Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.32Np Likeness Score: -1.16
References 1. Razdan RK, Bruni RJ, Mehta AC, Weinhardt KK, Papanastassiou ZB.. (1978) A new class of antimalarial drugs: derivatives of benzothiopyrans., 21 (7): [PMID:353282 ] [10.1021/jm00205a010 ]