N4-(2-(3,4-dichlorophenyl)-6-methoxy-4H-thiochromen-4-ylidene)-N1,N1-diethylpentane-1,4-diamine dihydrochloride

ID: ALA3249015

PubChem CID: 90673560

Max Phase: Preclinical

Molecular Formula: C25H31Cl3N2OS

Molecular Weight: 477.50

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCN(CC)CCCC(C)/N=c1\cc(-c2ccc(Cl)c(Cl)c2)sc2ccc(OC)cc12.Cl

Standard InChI:  InChI=1S/C25H30Cl2N2OS.ClH/c1-5-29(6-2)13-7-8-17(3)28-23-16-25(18-9-11-21(26)22(27)14-18)31-24-12-10-19(30-4)15-20(23)24;/h9-12,14-17H,5-8,13H2,1-4H3;1H/b28-23+;

Standard InChI Key:  WQDCXSZPUMNONV-XVBNZNTOSA-N

Molfile:  

     RDKit          2D

 32 33  0  0  0  0  0  0  0  0999 V2000
   20.9129  -30.6153    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   12.4917  -28.7461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4906  -29.5656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1986  -29.9746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1968  -28.3372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9054  -28.7425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9062  -29.5615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6147  -29.9686    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   15.3230  -29.5578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3183  -28.7356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6091  -28.3323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6048  -27.5151    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.0287  -29.9595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0306  -30.7778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7390  -31.1836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4461  -30.7722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4403  -29.9508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7313  -29.5487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3103  -27.1028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0202  -27.5076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7257  -27.0952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3060  -26.2856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4356  -27.5001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1411  -27.0877    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.8510  -27.4926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1368  -26.2706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8423  -25.8582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5565  -27.0802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7908  -28.3377    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.1560  -31.1771    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   18.1450  -29.5370    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   11.7941  -27.5205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  3  4  1  0
  4  7  2  0
  6  5  2  0
  5  2  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11  6  1  0
 11 12  2  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
  9 13  1  0
 12 19  1  0
 19 20  1  0
 20 21  1  0
 19 22  1  0
 21 23  1  0
 23 24  1  0
 24 25  1  0
 24 26  1  0
 26 27  1  0
 25 28  1  0
  2 29  1  0
 16 30  1  0
 17 31  1  0
 29 32  1  0
M  END

Associated Targets(non-human)

Plasmodium gallinaceum (527 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 477.50Molecular Weight (Monoisotopic): 476.1456AlogP: 7.29#Rotatable Bonds: 9
Polar Surface Area: 24.83Molecular Species: BASEHBA: 4HBD:
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 10.32CX LogP: 6.45CX LogD: 3.63
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.32Np Likeness Score: -1.16

References

1. Razdan RK, Bruni RJ, Mehta AC, Weinhardt KK, Papanastassiou ZB..  (1978)  A new class of antimalarial drugs: derivatives of benzothiopyrans.,  21  (7): [PMID:353282] [10.1021/jm00205a010]

Source