The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2,3-Dihydro-2-[3-(1-piperidinopropyl)]-9-phenyl-1H-indeno[2,1-c]pyridine dihydrobromide hydrate ID: ALA3249168
PubChem CID: 90673608
Max Phase: Preclinical
Molecular Formula: C26H33BrN2O
Molecular Weight: 370.54
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Br.C1=C2C(=C(c3ccccc3)c3ccccc32)CN(CCCN2CCCCC2)C1.O
Standard InChI: InChI=1S/C26H30N2.BrH.H2O/c1-3-10-21(11-4-1)26-24-13-6-5-12-22(24)23-14-19-28(20-25(23)26)18-9-17-27-15-7-2-8-16-27;;/h1,3-6,10-14H,2,7-9,15-20H2;1H;1H2
Standard InChI Key: HTXUCJAPZYDBKM-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
17.5396 -8.4756 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.9341 -6.9703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2014 -6.5913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1632 -5.7672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8579 -5.3221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5906 -5.7011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6288 -6.5252 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.4294 -6.8822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9141 -6.2379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0905 -6.1897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7205 -5.4523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1741 -4.7632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9977 -4.8114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3677 -5.5488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2110 -7.6777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4129 -7.8864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1944 -8.6819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7742 -9.2689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5724 -9.0602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7908 -8.2647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3616 -6.9042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0785 -6.4962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7904 -6.9130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5074 -6.5048 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.2166 -6.9267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9315 -6.5221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9408 -5.6968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2290 -5.2777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5079 -5.6840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5063 -8.8572 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 1 0
2 7 1 0
8 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
9 14 2 0
3 8 2 0
4 14 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
15 20 2 0
8 15 1 0
21 22 1 0
22 23 1 0
23 24 1 0
7 21 1 0
24 25 1 0
24 29 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 370.54Molecular Weight (Monoisotopic): 370.2409AlogP: 5.08#Rotatable Bonds: 5Polar Surface Area: 6.48Molecular Species: BASEHBA: 2HBD: ┄#RO5 Violations: 1HBA (Lipinski): 2HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 9.51CX LogP: 4.44CX LogD: 2.28Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.72Np Likeness Score: -0.15
References 1. Ellefson CR, Woo CM, Cusic JW.. (1978) Synthesis and antiarrhythmic activity of 2-dialkylaminoalkyl-9-phenyl-1H-indeno[2,1-c]pyridine derivatives., 21 (4): [PMID:650662 ] [10.1021/jm00202a005 ]