The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N10-Tosylisohomoaminopterin ID: ALA3249766
Cas Number: 66801-30-7
PubChem CID: 191819
Max Phase: Preclinical
Molecular Formula: C27H28N8O7S
Molecular Weight: 608.64
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(S(=O)(=O)N(Cc2ccc(C(=O)N[C@@H](CCC(=O)O)C(=O)O)cc2)Cc2cnc3nc(N)nc(N)c3n2)cc1
Standard InChI: InChI=1S/C27H28N8O7S/c1-15-2-8-19(9-3-15)43(41,42)35(14-18-12-30-24-22(31-18)23(28)33-27(29)34-24)13-16-4-6-17(7-5-16)25(38)32-20(26(39)40)10-11-21(36)37/h2-9,12,20H,10-11,13-14H2,1H3,(H,32,38)(H,36,37)(H,39,40)(H4,28,29,30,33,34)/t20-/m0/s1
Standard InChI Key: IRKCUNZPTXZRKL-FQEVSTJZSA-N
Molfile:
RDKit 2D
43 46 0 0 0 0 0 0 0 0999 V2000
28.3845 -8.3337 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.8011 -7.6211 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
27.9757 -7.6166 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.5162 -6.8169 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.5151 -7.6443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2299 -8.0572 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.2281 -6.4041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9435 -6.8133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9443 -7.6401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6596 -8.0511 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.3747 -7.6364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3698 -6.8063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6539 -6.3991 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.8002 -8.0563 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.2256 -5.5791 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.0819 -6.3894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7988 -6.7976 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.5108 -6.3807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4994 -5.5527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2106 -5.1348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2004 -4.3106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4801 -3.9064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7686 -4.3326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7824 -5.1554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5209 -8.0308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5242 -8.8556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2404 -9.2636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9534 -8.8468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9456 -8.0175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2289 -7.6132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6709 -9.2539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4684 -3.0815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1769 -2.6589 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.7481 -2.6792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.1652 -1.8339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8738 -1.4113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4449 -1.4316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4315 -0.6055 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.7355 -1.8546 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.5941 -1.8136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3026 -1.3910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0223 -1.7929 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.2904 -0.5657 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
5 14 1 0
7 15 1 0
12 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
17 2 1 0
2 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
28 31 1 0
22 32 1 0
32 33 1 0
32 34 2 0
35 33 1 6
35 36 1 0
35 37 1 0
37 38 1 0
37 39 2 0
36 40 1 0
40 41 1 0
41 42 1 0
41 43 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 608.64Molecular Weight (Monoisotopic): 608.1802AlogP: 1.33#Rotatable Bonds: 12Polar Surface Area: 244.68Molecular Species: ACIDHBA: 11HBD: 5#RO5 Violations: 2HBA (Lipinski): 15HBD (Lipinski): 7#RO5 Violations (Lipinski): 3CX Acidic pKa: 3.29CX Basic pKa: 2.82CX LogP: 0.96CX LogD: -5.40Aromatic Rings: 4Heavy Atoms: 43QED Weighted: 0.15Np Likeness Score: -0.84
References 1. Nair MG, O'Neal PC, Baugh CM, Kisliuk RL, Gaumont Y, Rodman M.. (1978) Folate analogues altered in the C9-N10 bridge region: N10-Toxylisohomofolic acid and N10-Toxylisohomoaminopterin., 21 (7): [PMID:97383 ] [10.1021/jm00205a015 ]