The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Methyl N10-Tosylisohomopteroate ID: ALA3249767
PubChem CID: 136498760
Max Phase: Preclinical
Molecular Formula: C23H22N6O5S
Molecular Weight: 494.53
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)c1ccc(CN(Cc2cnc3nc(N)nc(O)c3n2)S(=O)(=O)c2ccc(C)cc2)cc1
Standard InChI: InChI=1S/C23H22N6O5S/c1-14-3-9-18(10-4-14)35(32,33)29(12-15-5-7-16(8-6-15)22(31)34-2)13-17-11-25-20-19(26-17)21(30)28-23(24)27-20/h3-11H,12-13H2,1-2H3,(H3,24,25,27,28,30)
Standard InChI Key: GLUJRAZJRYZNSS-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
4.9073 -15.5968 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3200 -14.8910 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
4.5024 -14.8865 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0758 -14.0944 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.0746 -14.9140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7827 -15.3229 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7809 -13.6856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4895 -14.0908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4903 -14.9099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1988 -15.3169 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9071 -14.9061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9023 -14.0840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1932 -13.6806 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.3666 -15.3220 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7785 -12.8684 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6076 -13.6711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3177 -14.0754 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0229 -13.6625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0116 -12.8422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7161 -12.4283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7060 -11.6119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9925 -11.2117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2878 -11.6338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3015 -12.4488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0329 -15.2968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0362 -16.1138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7456 -16.5180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4518 -16.1050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4441 -15.2836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7342 -14.8831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1625 -16.5084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9809 -10.3946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6827 -9.9760 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2675 -9.9961 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3962 -10.3745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
5 14 1 0
7 15 1 0
12 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
17 2 1 0
2 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
28 31 1 0
22 32 1 0
32 33 1 0
32 34 2 0
33 35 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 494.53Molecular Weight (Monoisotopic): 494.1372AlogP: 2.19#Rotatable Bonds: 7Polar Surface Area: 161.49Molecular Species: NEUTRALHBA: 10HBD: 2#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.37CX Basic pKa: 2.81CX LogP: 2.94CX LogD: 2.94Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.36Np Likeness Score: -1.11
References 1. Nair MG, O'Neal PC, Baugh CM, Kisliuk RL, Gaumont Y, Rodman M.. (1978) Folate analogues altered in the C9-N10 bridge region: N10-Toxylisohomofolic acid and N10-Toxylisohomoaminopterin., 21 (7): [PMID:97383 ] [10.1021/jm00205a015 ]