Methyl N10-Tosylisohomopteroate

ID: ALA3249767

PubChem CID: 136498760

Max Phase: Preclinical

Molecular Formula: C23H22N6O5S

Molecular Weight: 494.53

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COC(=O)c1ccc(CN(Cc2cnc3nc(N)nc(O)c3n2)S(=O)(=O)c2ccc(C)cc2)cc1

Standard InChI:  InChI=1S/C23H22N6O5S/c1-14-3-9-18(10-4-14)35(32,33)29(12-15-5-7-16(8-6-15)22(31)34-2)13-17-11-25-20-19(26-17)21(30)28-23(24)27-20/h3-11H,12-13H2,1-2H3,(H3,24,25,27,28,30)

Standard InChI Key:  GLUJRAZJRYZNSS-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
    4.9073  -15.5968    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3200  -14.8910    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    4.5024  -14.8865    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0758  -14.0944    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0746  -14.9140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7827  -15.3229    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7809  -13.6856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4895  -14.0908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4903  -14.9099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1988  -15.3169    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9071  -14.9061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9023  -14.0840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1932  -13.6806    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3666  -15.3220    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7785  -12.8684    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6076  -13.6711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3177  -14.0754    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0229  -13.6625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0116  -12.8422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7161  -12.4283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7060  -11.6119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9925  -11.2117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2878  -11.6338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3015  -12.4488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0329  -15.2968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0362  -16.1138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7456  -16.5180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4518  -16.1050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4441  -15.2836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7342  -14.8831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1625  -16.5084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9809  -10.3946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6827   -9.9760    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2675   -9.9961    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3962  -10.3745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  9  2  0
  8  7  2  0
  7  4  1  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
  5 14  1  0
  7 15  1  0
 12 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 17  2  1  0
  2 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 28 31  1  0
 22 32  1  0
 32 33  1  0
 32 34  2  0
 33 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3249767

    ---

Associated Targets(non-human)

folA Dihydrofolate reductase (640 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
thyA Thymidylate synthase (501 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Lacticaseibacillus casei (578 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 494.53Molecular Weight (Monoisotopic): 494.1372AlogP: 2.19#Rotatable Bonds: 7
Polar Surface Area: 161.49Molecular Species: NEUTRALHBA: 10HBD: 2
#RO5 Violations: HBA (Lipinski): 11HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.37CX Basic pKa: 2.81CX LogP: 2.94CX LogD: 2.94
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.36Np Likeness Score: -1.11

References

1. Nair MG, O'Neal PC, Baugh CM, Kisliuk RL, Gaumont Y, Rodman M..  (1978)  Folate analogues altered in the C9-N10 bridge region: N10-Toxylisohomofolic acid and N10-Toxylisohomoaminopterin.,  21  (7): [PMID:97383] [10.1021/jm00205a015]

Source