The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
25-hydroxy-5,6-trans-vitamin D3 ID: ALA3250186
Cas Number: 1233749-00-2
PubChem CID: 6506392
Max Phase: Preclinical
Molecular Formula: C27H44O2
Molecular Weight: 400.65
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C=C1CC[C@H](O)C/C1=C\C=C1/CCC[C@]2(C)[C@@H]([C@H](C)CCCC(C)(C)O)CC[C@@H]12
Standard InChI: InChI=1S/C27H44O2/c1-19-10-13-23(28)18-22(19)12-11-21-9-7-17-27(5)24(14-15-25(21)27)20(2)8-6-16-26(3,4)29/h11-12,20,23-25,28-29H,1,6-10,13-18H2,2-5H3/b21-11+,22-12+/t20-,23+,24-,25+,27-/m1/s1
Standard InChI Key: JWUBBDSIWDLEOM-WIFPIRAHSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
5.8609 -5.7091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5779 -2.8262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7193 -2.9687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5755 -4.4716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0695 -2.9906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5755 -5.2966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8609 -6.5342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5730 -7.7759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5730 -6.9508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2974 -2.2598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0679 -4.3159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8609 -8.1841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4724 -2.2707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5504 -3.6539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8616 -3.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1489 -6.9508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2823 -2.4174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2906 -3.2425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0505 -1.5618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5442 -2.9578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3740 -4.3758 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.7912 -3.6558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2823 -4.8841 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
7.2894 -4.0616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8490 -3.7841 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
10.9662 -3.6668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1489 -7.7759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5632 -4.3866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8580 -4.0651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4400 -6.5443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2801 -8.1855 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7 1 2 0
24 23 1 6
18 2 1 0
26 21 1 0
6 4 2 0
18 24 1 0
16 7 1 0
16 27 1 0
24 11 1 0
26 22 1 0
10 3 1 0
8 9 1 0
11 14 1 0
3 20 1 0
1 6 1 0
5 13 1 0
12 8 1 0
5 25 1 6
2 15 1 0
13 10 1 0
27 12 1 0
26 28 1 0
4 24 1 0
20 26 1 0
13 19 1 6
4 29 1 0
9 7 1 0
15 29 1 0
5 18 1 0
18 17 1 1
14 5 1 0
16 30 2 0
8 31 1 1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 400.65Molecular Weight (Monoisotopic): 400.3341AlogP: 6.73#Rotatable Bonds: 6Polar Surface Area: 40.46Molecular Species: NEUTRALHBA: 2HBD: 2#RO5 Violations: 1HBA (Lipinski): 2HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.65CX LogD: 5.65Aromatic Rings: ┄Heavy Atoms: 29QED Weighted: 0.52Np Likeness Score: 2.63
References 1. Mouriño A, Blair P, Wecksler W, Johnson RL, Norman AW, Okamura WH.. (1978) Studies on vitamin D (calciferol) and its analogues. 15. 24-Nor-1alpha,25-dihydroxyvitamin D3 and 24-nor-25-hydroxy-5,6-trans-vitamin D3., 21 (10): [PMID:214553 ] [10.1021/jm00208a005 ]