The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-Butyl-2-dodecylphenanthridin-6(5H)-one ID: ALA3259998
PubChem CID: 71082513
Max Phase: Preclinical
Molecular Formula: C29H41NO
Molecular Weight: 419.65
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCCCCCCc1ccc2c(c1)c1ccccc1c(=O)n2CCCC
Standard InChI: InChI=1S/C29H41NO/c1-3-5-7-8-9-10-11-12-13-14-17-24-20-21-28-27(23-24)25-18-15-16-19-26(25)29(31)30(28)22-6-4-2/h15-16,18-21,23H,3-14,17,22H2,1-2H3
Standard InChI Key: RGGBCIXXCKHJON-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
16.9821 -21.3212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9810 -22.1408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6890 -22.5497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6872 -20.9124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3959 -21.3176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3947 -22.1428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8218 -21.3197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1071 -20.9038 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.8206 -22.1449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1042 -22.5517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0993 -23.3737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8101 -23.7899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5273 -23.3780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5287 -22.5573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5305 -20.9128 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.1072 -20.0866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8149 -19.6780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8149 -18.8608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5227 -18.4523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2730 -22.5488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5656 -22.1396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5662 -21.3224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8588 -20.9133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8595 -20.0961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5675 -19.6881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2749 -20.0972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9829 -19.6892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9836 -18.8720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2762 -18.4628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5682 -18.8709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8608 -18.4617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 8 1 0
6 10 1 0
9 7 1 0
7 8 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
7 15 2 0
8 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
2 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 419.65Molecular Weight (Monoisotopic): 419.3188AlogP: 8.42#Rotatable Bonds: 14Polar Surface Area: 22.00Molecular Species: NEUTRALHBA: 2HBD: ┄#RO5 Violations: 1HBA (Lipinski): 2HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 9.33CX LogD: 9.33Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.19Np Likeness Score: -0.41
References 1. Nishiyama Y, Nakamura M, Misawa T, Nakagomi M, Makishima M, Ishikawa M, Hashimoto Y.. (2014) Structure-activity relationship-guided development of retinoic acid receptor-related orphan receptor gamma (RORγ)-selective inverse agonists with a phenanthridin-6(5H)-one skeleton from a liver X receptor ligand., 22 (9): [PMID:24702856 ] [10.1016/j.bmc.2014.03.007 ]