3-(5-(3-(3-chlorobenzyloxy)phenyl)-1-(3-methylbenzylamino)pentylidene)-5-(hydroxymethyl)furan-2,4(3H,5H)-dione

ID: ALA3260371

PubChem CID: 136498873

Max Phase: Preclinical

Molecular Formula: C31H32ClNO5

Molecular Weight: 534.05

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cccc(CN/C(CCCCc2cccc(OCc3cccc(Cl)c3)c2)=C2\C(=O)OC(CO)C2=O)c1

Standard InChI:  InChI=1S/C31H32ClNO5/c1-21-7-4-10-23(15-21)18-33-27(29-30(35)28(19-34)38-31(29)36)14-3-2-8-22-9-6-13-26(17-22)37-20-24-11-5-12-25(32)16-24/h4-7,9-13,15-17,28,33-34H,2-3,8,14,18-20H2,1H3/b29-27-

Standard InChI Key:  LLDSXPXAKDEOOZ-OHYPFYFLSA-N

Molfile:  

     RDKit          2D

 38 41  0  0  0  0  0  0  0  0999 V2000
   11.9304   -5.4685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9293   -6.2881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6373   -6.6970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3470   -6.2876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3441   -5.4649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6355   -5.0597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6371   -7.5142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3447   -7.9230    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.3445   -8.7402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6367   -9.1486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0521   -9.1490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1362   -9.9630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9355  -10.1331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3443   -9.4254    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.7976   -8.8181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9680   -8.0189    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.5284  -10.5092    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.2677  -10.8797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7873  -11.5407    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.0503   -5.0537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9291   -8.7398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2213   -9.1483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5137   -8.7395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8057   -9.9651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8080   -9.1517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1058   -8.7448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4009   -9.1501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4025   -9.9667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1052  -10.3699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1065  -11.1871    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.3994  -11.5968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4007  -12.4140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6933  -12.8186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6942  -13.6350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4031  -14.0433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1125  -13.6293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1081  -12.8142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8223  -14.0343    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  3  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  9 11  2  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 11  1  0
 15 16  2  0
 12 17  2  0
 13 18  1  0
 18 19  1  0
  5 20  1  0
 10 21  1  0
 21 22  1  0
 22 23  1  0
 23 25  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 32  1  0
 36 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3260371

    ---

Associated Targets(Human)

DUSP3 Tchem Dual specificity protein phosphatase 3 (1161 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HeLa (62764 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 534.05Molecular Weight (Monoisotopic): 533.1969AlogP: 5.47#Rotatable Bonds: 12
Polar Surface Area: 84.86Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 10.41CX Basic pKa: CX LogP: 6.73CX LogD: 6.73
Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.14Np Likeness Score: -0.38

References

1. Thuaud F, Kojima S, Hirai G, Oonuma K, Tsuchiya A, Uchida T, Tsuchimoto T, Sodeoka M..  (2014)  RE12 derivatives displaying Vaccinia H1-related phosphatase (VHR) inhibition in the presence of detergent and their anti-proliferative activity against HeLa cells.,  22  (9): [PMID:24702858] [10.1016/j.bmc.2014.03.012]

Source