3-(5-(3-(4-chlorobenzyloxy)phenyl)-1-(3-methylbenzylamino)pentylidene)-5-(hydroxymethyl)furan-2,4(3H,5H)-dione

ID: ALA3260372

PubChem CID: 136498874

Max Phase: Preclinical

Molecular Formula: C31H32ClNO5

Molecular Weight: 534.05

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cccc(CN/C(CCCCc2cccc(OCc3ccc(Cl)cc3)c2)=C2\C(=O)OC(CO)C2=O)c1

Standard InChI:  InChI=1S/C31H32ClNO5/c1-21-6-4-9-24(16-21)18-33-27(29-30(35)28(19-34)38-31(29)36)11-3-2-7-22-8-5-10-26(17-22)37-20-23-12-14-25(32)15-13-23/h4-6,8-10,12-17,28,33-34H,2-3,7,11,18-20H2,1H3/b29-27-

Standard InChI Key:  PYSZHWWEKGUFSS-OHYPFYFLSA-N

Molfile:  

     RDKit          2D

 38 41  0  0  0  0  0  0  0  0999 V2000
   20.9566   -5.5428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9555   -6.3624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6635   -6.7713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3732   -6.3619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3704   -5.5392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6618   -5.1340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6633   -7.5885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3710   -7.9973    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.3708   -8.8145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6630   -9.2229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0784   -9.2233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1625  -10.0373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9618  -10.2074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3706   -9.4997    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.8239   -8.8924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9943   -8.0932    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.5547  -10.5835    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.2940  -10.9540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8135  -11.6150    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.0765   -5.1280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9553   -8.8141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2475   -9.2226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5399   -8.8138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8319  -10.0394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8342   -9.2260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1321   -8.8191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4271   -9.2244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4287  -10.0409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1315  -10.4442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1327  -11.2614    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.4257  -11.6711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4269  -12.4883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7196  -12.8929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7205  -13.7093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4294  -14.1176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1388  -13.7036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1344  -12.8885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4317  -14.9348    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  3  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  9 11  2  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 11  1  0
 15 16  2  0
 12 17  2  0
 13 18  1  0
 18 19  1  0
  5 20  1  0
 10 21  1  0
 21 22  1  0
 22 23  1  0
 23 25  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 32  1  0
 35 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3260372

    ---

Associated Targets(Human)

DUSP3 Tchem Dual specificity protein phosphatase 3 (1161 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HeLa (62764 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 534.05Molecular Weight (Monoisotopic): 533.1969AlogP: 5.47#Rotatable Bonds: 12
Polar Surface Area: 84.86Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 10.41CX Basic pKa: CX LogP: 6.73CX LogD: 6.73
Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.14Np Likeness Score: -0.31

References

1. Thuaud F, Kojima S, Hirai G, Oonuma K, Tsuchiya A, Uchida T, Tsuchimoto T, Sodeoka M..  (2014)  RE12 derivatives displaying Vaccinia H1-related phosphatase (VHR) inhibition in the presence of detergent and their anti-proliferative activity against HeLa cells.,  22  (9): [PMID:24702858] [10.1016/j.bmc.2014.03.012]

Source