The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(5-(2-(benzyloxy)phenyl)-1-(3-methylbenzylamino)pentylidene)-5-(hydroxymethyl)furan-2,4(3H,5H)-dione ID: ALA3260373
PubChem CID: 136498875
Max Phase: Preclinical
Molecular Formula: C31H33NO5
Molecular Weight: 499.61
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cccc(CN/C(CCCCc2ccccc2OCc2ccccc2)=C2\C(=O)OC(CO)C2=O)c1
Standard InChI: InChI=1S/C31H33NO5/c1-22-10-9-13-24(18-22)19-32-26(29-30(34)28(20-33)37-31(29)35)16-7-5-14-25-15-6-8-17-27(25)36-21-23-11-3-2-4-12-23/h2-4,6,8-13,15,17-18,28,32-33H,5,7,14,16,19-21H2,1H3/b29-26-
Standard InChI Key: NKCGVZGLFPXKML-WCTVFOPTSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
28.7819 -7.2102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7807 -8.0298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4888 -8.4387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1984 -8.0293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1956 -7.2066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4870 -6.8014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4886 -9.2559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1962 -9.6647 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.1960 -10.4819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4882 -10.8903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9036 -10.8907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9877 -11.7047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7870 -11.8748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1958 -11.1671 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.6491 -10.5598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8195 -9.7606 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.3799 -12.2509 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.1192 -12.6214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6387 -13.2824 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.9018 -6.7954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7806 -10.4815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0728 -10.8900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3651 -10.4812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3648 -12.1156 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.3646 -12.9328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6571 -11.7068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6595 -10.8934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9573 -10.4865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2523 -10.8918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2540 -11.7083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9567 -12.1116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0720 -13.3392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0720 -14.1587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7806 -14.5667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4897 -14.1563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4858 -13.3336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7766 -12.9293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
3 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
9 11 2 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 11 1 0
15 16 2 0
12 17 2 0
13 18 1 0
18 19 1 0
5 20 1 0
10 21 1 0
21 22 1 0
22 23 1 0
23 27 1 0
26 24 1 0
24 25 1 0
25 32 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 499.61Molecular Weight (Monoisotopic): 499.2359AlogP: 4.82#Rotatable Bonds: 12Polar Surface Area: 84.86Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.41CX Basic pKa: ┄CX LogP: 6.12CX LogD: 6.12Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.16Np Likeness Score: -0.14
References 1. Thuaud F, Kojima S, Hirai G, Oonuma K, Tsuchiya A, Uchida T, Tsuchimoto T, Sodeoka M.. (2014) RE12 derivatives displaying Vaccinia H1-related phosphatase (VHR) inhibition in the presence of detergent and their anti-proliferative activity against HeLa cells., 22 (9): [PMID:24702858 ] [10.1016/j.bmc.2014.03.012 ]