3-(5-(2-(benzyloxy)phenyl)-1-(3-methylbenzylamino)pentylidene)-5-(hydroxymethyl)furan-2,4(3H,5H)-dione

ID: ALA3260373

PubChem CID: 136498875

Max Phase: Preclinical

Molecular Formula: C31H33NO5

Molecular Weight: 499.61

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cccc(CN/C(CCCCc2ccccc2OCc2ccccc2)=C2\C(=O)OC(CO)C2=O)c1

Standard InChI:  InChI=1S/C31H33NO5/c1-22-10-9-13-24(18-22)19-32-26(29-30(34)28(20-33)37-31(29)35)16-7-5-14-25-15-6-8-17-27(25)36-21-23-11-3-2-4-12-23/h2-4,6,8-13,15,17-18,28,32-33H,5,7,14,16,19-21H2,1H3/b29-26-

Standard InChI Key:  NKCGVZGLFPXKML-WCTVFOPTSA-N

Molfile:  

     RDKit          2D

 37 40  0  0  0  0  0  0  0  0999 V2000
   28.7819   -7.2102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7807   -8.0298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4888   -8.4387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1984   -8.0293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1956   -7.2066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4870   -6.8014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4886   -9.2559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1962   -9.6647    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.1960  -10.4819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4882  -10.8903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9036  -10.8907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9877  -11.7047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7870  -11.8748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1958  -11.1671    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.6491  -10.5598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8195   -9.7606    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.3799  -12.2509    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.1192  -12.6214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6387  -13.2824    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.9018   -6.7954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7806  -10.4815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0728  -10.8900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3651  -10.4812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3648  -12.1156    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.3646  -12.9328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6571  -11.7068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6595  -10.8934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9573  -10.4865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2523  -10.8918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2540  -11.7083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9567  -12.1116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0720  -13.3392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0720  -14.1587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7806  -14.5667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4897  -14.1563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4858  -13.3336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7766  -12.9293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  3  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  9 11  2  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 11  1  0
 15 16  2  0
 12 17  2  0
 13 18  1  0
 18 19  1  0
  5 20  1  0
 10 21  1  0
 21 22  1  0
 22 23  1  0
 23 27  1  0
 26 24  1  0
 24 25  1  0
 25 32  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3260373

    ---

Associated Targets(Human)

DUSP3 Tchem Dual specificity protein phosphatase 3 (1161 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HeLa (62764 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 499.61Molecular Weight (Monoisotopic): 499.2359AlogP: 4.82#Rotatable Bonds: 12
Polar Surface Area: 84.86Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 10.41CX Basic pKa: CX LogP: 6.12CX LogD: 6.12
Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.16Np Likeness Score: -0.14

References

1. Thuaud F, Kojima S, Hirai G, Oonuma K, Tsuchiya A, Uchida T, Tsuchimoto T, Sodeoka M..  (2014)  RE12 derivatives displaying Vaccinia H1-related phosphatase (VHR) inhibition in the presence of detergent and their anti-proliferative activity against HeLa cells.,  22  (9): [PMID:24702858] [10.1016/j.bmc.2014.03.012]

Source