5-(hydroxymethyl)-3-(1-(3-methylbenzylamino)-5-(2-(4-(trifluoromethyl)benzyloxy)phenyl)pentylidene)furan-2,4(3H,5H)-dione

ID: ALA3260374

PubChem CID: 136498876

Max Phase: Preclinical

Molecular Formula: C32H32F3NO5

Molecular Weight: 567.60

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cccc(CN/C(CCCCc2ccccc2OCc2ccc(C(F)(F)F)cc2)=C2\C(=O)OC(CO)C2=O)c1

Standard InChI:  InChI=1S/C32H32F3NO5/c1-21-7-6-8-23(17-21)18-36-26(29-30(38)28(19-37)41-31(29)39)11-4-2-9-24-10-3-5-12-27(24)40-20-22-13-15-25(16-14-22)32(33,34)35/h3,5-8,10,12-17,28,36-37H,2,4,9,11,18-20H2,1H3/b29-26-

Standard InChI Key:  XYDRKQFLJWNYCK-WCTVFOPTSA-N

Molfile:  

     RDKit          2D

 41 44  0  0  0  0  0  0  0  0999 V2000
    0.4237  -14.8786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4225  -15.6982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1306  -16.1071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8402  -15.6977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8374  -14.8750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1288  -14.4698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1304  -16.9243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8380  -17.3331    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8378  -18.1503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1300  -18.5587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5454  -18.5590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6295  -19.3731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4288  -19.5432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8376  -18.8355    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2909  -18.2282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4613  -17.4290    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0217  -19.9193    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7610  -20.2898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2805  -20.9508    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5436  -14.4638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4224  -18.1499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2924  -18.5583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9963  -18.1496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9959  -19.7840    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9957  -20.6012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7080  -19.3752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7021  -18.5618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4032  -18.1549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1098  -18.5602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1114  -19.3767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4026  -19.7800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2916  -21.0076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2916  -21.8271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4224  -22.2351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1315  -21.8247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1276  -21.0020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4184  -20.5977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8404  -22.2312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8428  -23.0484    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.5469  -21.8206    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.5424  -22.6378    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  3  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  9 11  2  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 11  1  0
 15 16  2  0
 12 17  2  0
 13 18  1  0
 18 19  1  0
  5 20  1  0
 10 21  1  0
 21 22  1  0
 22 23  1  0
 23 27  1  0
 26 24  1  0
 24 25  1  0
 25 32  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 32  1  0
 35 38  1  0
 38 39  1  0
 38 40  1  0
 38 41  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3260374

    ---

Associated Targets(Human)

DUSP3 Tchem Dual specificity protein phosphatase 3 (1161 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HeLa (62764 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 567.60Molecular Weight (Monoisotopic): 567.2233AlogP: 5.84#Rotatable Bonds: 12
Polar Surface Area: 84.86Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 10.41CX Basic pKa: CX LogP: 7.00CX LogD: 7.00
Aromatic Rings: 3Heavy Atoms: 41QED Weighted: 0.12Np Likeness Score: -0.37

References

1. Thuaud F, Kojima S, Hirai G, Oonuma K, Tsuchiya A, Uchida T, Tsuchimoto T, Sodeoka M..  (2014)  RE12 derivatives displaying Vaccinia H1-related phosphatase (VHR) inhibition in the presence of detergent and their anti-proliferative activity against HeLa cells.,  22  (9): [PMID:24702858] [10.1016/j.bmc.2014.03.012]

Source