The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(hydroxymethyl)-3-(1-(3-methylbenzylamino)-5-(2-(4-nitrobenzyloxy)phenyl)pentylidene)furan-2,4(3H,5H)-dione ID: ALA3260375
PubChem CID: 136498877
Max Phase: Preclinical
Molecular Formula: C31H32N2O7
Molecular Weight: 544.60
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cccc(CN/C(CCCCc2ccccc2OCc2ccc([N+](=O)[O-])cc2)=C2\C(=O)OC(CO)C2=O)c1
Standard InChI: InChI=1S/C31H32N2O7/c1-21-7-6-8-23(17-21)18-32-26(29-30(35)28(19-34)40-31(29)36)11-4-2-9-24-10-3-5-12-27(24)39-20-22-13-15-25(16-14-22)33(37)38/h3,5-8,10,12-17,28,32,34H,2,4,9,11,18-20H2,1H3/b29-26-
Standard InChI Key: IPRQIYMDZPQRFL-WCTVFOPTSA-N
Molfile:
RDKit 2D
40 43 0 0 0 0 0 0 0 0999 V2000
8.6864 -15.5596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6853 -16.3792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3933 -16.7881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1030 -16.3787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1001 -15.5560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3915 -15.1508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3931 -17.6053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1007 -18.0141 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.1005 -18.8313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3927 -19.2397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8081 -19.2400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8922 -20.0540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6915 -20.2241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1003 -19.5165 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5536 -18.9092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7240 -18.1099 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.2844 -20.6003 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.0237 -20.9708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5433 -21.6318 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.8063 -15.1448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6851 -18.8309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9773 -19.2393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2697 -18.8306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2693 -20.4650 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2691 -21.2821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5617 -20.0562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5640 -19.2428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8618 -18.8358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1569 -19.2412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1585 -20.0577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8612 -20.4610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9765 -21.6885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9765 -22.5081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6851 -22.9161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3942 -22.5057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3903 -21.6830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6811 -21.2787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1078 -22.9120 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.8144 -22.5013 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.1102 -23.7292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
3 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
9 11 2 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 11 1 0
15 16 2 0
12 17 2 0
13 18 1 0
18 19 1 0
5 20 1 0
10 21 1 0
21 22 1 0
22 23 1 0
23 27 1 0
26 24 1 0
24 25 1 0
25 32 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 32 1 0
38 39 2 0
38 40 1 0
35 38 1 0
M CHG 2 38 1 40 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 544.60Molecular Weight (Monoisotopic): 544.2210AlogP: 4.73#Rotatable Bonds: 13Polar Surface Area: 128.00Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.41CX Basic pKa: ┄CX LogP: 6.06CX LogD: 6.06Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.08Np Likeness Score: -0.41
References 1. Thuaud F, Kojima S, Hirai G, Oonuma K, Tsuchiya A, Uchida T, Tsuchimoto T, Sodeoka M.. (2014) RE12 derivatives displaying Vaccinia H1-related phosphatase (VHR) inhibition in the presence of detergent and their anti-proliferative activity against HeLa cells., 22 (9): [PMID:24702858 ] [10.1016/j.bmc.2014.03.012 ]