5-(hydroxymethyl)-3-(1-(3-methylbenzylamino)-5-(2-(4-nitrobenzyloxy)phenyl)pentylidene)furan-2,4(3H,5H)-dione

ID: ALA3260375

PubChem CID: 136498877

Max Phase: Preclinical

Molecular Formula: C31H32N2O7

Molecular Weight: 544.60

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cccc(CN/C(CCCCc2ccccc2OCc2ccc([N+](=O)[O-])cc2)=C2\C(=O)OC(CO)C2=O)c1

Standard InChI:  InChI=1S/C31H32N2O7/c1-21-7-6-8-23(17-21)18-32-26(29-30(35)28(19-34)40-31(29)36)11-4-2-9-24-10-3-5-12-27(24)39-20-22-13-15-25(16-14-22)33(37)38/h3,5-8,10,12-17,28,32,34H,2,4,9,11,18-20H2,1H3/b29-26-

Standard InChI Key:  IPRQIYMDZPQRFL-WCTVFOPTSA-N

Molfile:  

     RDKit          2D

 40 43  0  0  0  0  0  0  0  0999 V2000
    8.6864  -15.5596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6853  -16.3792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3933  -16.7881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1030  -16.3787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1001  -15.5560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3915  -15.1508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3931  -17.6053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1007  -18.0141    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.1005  -18.8313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3927  -19.2397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8081  -19.2400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8922  -20.0540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6915  -20.2241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1003  -19.5165    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.5536  -18.9092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7240  -18.1099    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.2844  -20.6003    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.0237  -20.9708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5433  -21.6318    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.8063  -15.1448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6851  -18.8309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9773  -19.2393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2697  -18.8306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2693  -20.4650    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2691  -21.2821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5617  -20.0562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5640  -19.2428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8618  -18.8358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1569  -19.2412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1585  -20.0577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8612  -20.4610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9765  -21.6885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9765  -22.5081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6851  -22.9161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3942  -22.5057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3903  -21.6830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6811  -21.2787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1078  -22.9120    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.8144  -22.5013    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.1102  -23.7292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  3  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  9 11  2  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 11  1  0
 15 16  2  0
 12 17  2  0
 13 18  1  0
 18 19  1  0
  5 20  1  0
 10 21  1  0
 21 22  1  0
 22 23  1  0
 23 27  1  0
 26 24  1  0
 24 25  1  0
 25 32  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 32  1  0
 38 39  2  0
 38 40  1  0
 35 38  1  0
M  CHG  2  38   1  40  -1
M  END

Alternative Forms

  1. Parent:

    ALA3260375

    ---

Associated Targets(Human)

DUSP3 Tchem Dual specificity protein phosphatase 3 (1161 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HeLa (62764 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 544.60Molecular Weight (Monoisotopic): 544.2210AlogP: 4.73#Rotatable Bonds: 13
Polar Surface Area: 128.00Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.41CX Basic pKa: CX LogP: 6.06CX LogD: 6.06
Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.08Np Likeness Score: -0.41

References

1. Thuaud F, Kojima S, Hirai G, Oonuma K, Tsuchiya A, Uchida T, Tsuchimoto T, Sodeoka M..  (2014)  RE12 derivatives displaying Vaccinia H1-related phosphatase (VHR) inhibition in the presence of detergent and their anti-proliferative activity against HeLa cells.,  22  (9): [PMID:24702858] [10.1016/j.bmc.2014.03.012]

Source