3-(5-(4-(2-chlorobenzyloxy)phenyl)-1-(3-methylbenzylamino)pentylidene)-5-(hydroxymethyl)furan-2,4(3H,5H)-dione

ID: ALA3260376

PubChem CID: 136056513

Max Phase: Preclinical

Molecular Formula: C31H32ClNO5

Molecular Weight: 534.05

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cccc(CN/C(CCCCc2ccc(OCc3ccccc3Cl)cc2)=C2\C(=O)OC(CO)C2=O)c1

Standard InChI:  InChI=1S/C31H32ClNO5/c1-21-7-6-9-23(17-21)18-33-27(29-30(35)28(19-34)38-31(29)36)12-5-2-8-22-13-15-25(16-14-22)37-20-24-10-3-4-11-26(24)32/h3-4,6-7,9-11,13-17,28,33-34H,2,5,8,12,18-20H2,1H3/b29-27-

Standard InChI Key:  BRKUVXZWVSJHJE-OHYPFYFLSA-N

Molfile:  

     RDKit          2D

 38 41  0  0  0  0  0  0  0  0999 V2000
   20.5657  -16.3337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5645  -17.1610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2794  -17.5739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9958  -17.1606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9930  -16.3300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2776  -15.9208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2792  -18.3990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9936  -18.8117    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.9934  -19.6367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2788  -20.0490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7077  -20.0493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7926  -20.8711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5996  -21.0428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0123  -20.3285    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.4604  -19.7153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6324  -18.9084    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.1790  -21.4225    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.9350  -21.7967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4499  -22.4640    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.7059  -15.9148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5644  -19.6363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8498  -20.0486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1354  -19.6360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4207  -20.8733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4230  -20.0521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7141  -19.6412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0023  -20.0505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0040  -20.8749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7135  -21.2820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2905  -21.2891    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.5751  -20.8782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8615  -21.2923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1460  -20.8798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4329  -21.2933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4345  -22.1192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1549  -22.5299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8650  -22.1140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5816  -22.5228    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  3  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  9 11  2  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 11  1  0
 15 16  2  0
 12 17  2  0
 13 18  1  0
 18 19  1  0
  5 20  1  0
 10 21  1  0
 21 22  1  0
 22 23  1  0
 23 25  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 28 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 32  1  0
 37 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3260376

    ---

Associated Targets(Human)

DUSP3 Tchem Dual specificity protein phosphatase 3 (1161 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HeLa (62764 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 534.05Molecular Weight (Monoisotopic): 533.1969AlogP: 5.47#Rotatable Bonds: 12
Polar Surface Area: 84.86Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 10.41CX Basic pKa: CX LogP: 6.73CX LogD: 6.73
Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.14Np Likeness Score: -0.42

References

1. Thuaud F, Kojima S, Hirai G, Oonuma K, Tsuchiya A, Uchida T, Tsuchimoto T, Sodeoka M..  (2014)  RE12 derivatives displaying Vaccinia H1-related phosphatase (VHR) inhibition in the presence of detergent and their anti-proliferative activity against HeLa cells.,  22  (9): [PMID:24702858] [10.1016/j.bmc.2014.03.012]

Source