3-(5-(4-(4-chlorobenzyloxy)phenyl)-1-(3-methylbenzylamino)pentylidene)-5-(hydroxymethyl)furan-2,4(3H,5H)-dione

ID: ALA3260378

PubChem CID: 136056515

Max Phase: Preclinical

Molecular Formula: C31H32ClNO5

Molecular Weight: 534.05

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cccc(CN/C(CCCCc2ccc(OCc3ccc(Cl)cc3)cc2)=C2\C(=O)OC(CO)C2=O)c1

Standard InChI:  InChI=1S/C31H32ClNO5/c1-21-5-4-7-24(17-21)18-33-27(29-30(35)28(19-34)38-31(29)36)8-3-2-6-22-11-15-26(16-12-22)37-20-23-9-13-25(32)14-10-23/h4-5,7,9-17,28,33-34H,2-3,6,8,18-20H2,1H3/b29-27-

Standard InChI Key:  YRYTYISGHZTXLY-OHYPFYFLSA-N

Molfile:  

     RDKit          2D

 38 41  0  0  0  0  0  0  0  0999 V2000
   21.9447  -24.5211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9435  -25.3484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6583  -25.7613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3748  -25.3480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3719  -24.5174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6565  -24.1083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6581  -26.5863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3725  -26.9991    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.3723  -27.8241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6577  -28.2364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0867  -28.2367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1716  -29.0585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9785  -29.2302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3912  -28.5158    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.8393  -27.9027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0113  -27.0958    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.5579  -29.6099    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.3139  -29.9840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8288  -30.6514    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.0848  -24.1022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9433  -27.8237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2288  -28.2360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5144  -27.8234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7996  -29.0607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8020  -28.2395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0930  -27.8286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3814  -28.2379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3830  -29.0622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0924  -29.4694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6694  -29.4764    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.9541  -29.0655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2405  -29.4797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5250  -29.0672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8120  -29.4807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8135  -30.3065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5339  -30.7172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2440  -30.3013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1005  -30.7216    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  3  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  9 11  2  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 11  1  0
 15 16  2  0
 12 17  2  0
 13 18  1  0
 18 19  1  0
  5 20  1  0
 10 21  1  0
 21 22  1  0
 22 23  1  0
 23 25  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 28 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 32  1  0
 35 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3260378

    ---

Associated Targets(Human)

DUSP3 Tchem Dual specificity protein phosphatase 3 (1161 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HeLa (62764 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 534.05Molecular Weight (Monoisotopic): 533.1969AlogP: 5.47#Rotatable Bonds: 12
Polar Surface Area: 84.86Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 10.41CX Basic pKa: CX LogP: 6.73CX LogD: 6.73
Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.14Np Likeness Score: -0.29

References

1. Thuaud F, Kojima S, Hirai G, Oonuma K, Tsuchiya A, Uchida T, Tsuchimoto T, Sodeoka M..  (2014)  RE12 derivatives displaying Vaccinia H1-related phosphatase (VHR) inhibition in the presence of detergent and their anti-proliferative activity against HeLa cells.,  22  (9): [PMID:24702858] [10.1016/j.bmc.2014.03.012]

Source