The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Diethylcarbamazinee Citrate ID: ALA3260659
PubChem CID: 90675723
Max Phase: Preclinical
Molecular Formula: C17H30N2O8
Molecular Weight: 198.31
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCN(CC)C(=O)N1CCC(C)CC1.O=C(O)CC(O)(CC(=O)O)C(=O)O
Standard InChI: InChI=1S/C11H22N2O.C6H8O7/c1-4-12(5-2)11(14)13-8-6-10(3)7-9-13;7-3(8)1-6(13,5(11)12)2-4(9)10/h10H,4-9H2,1-3H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)
Standard InChI Key: LYZXFWXEWWKVNS-UHFFFAOYSA-N
Molfile:
RDKit 2D
27 26 0 0 0 0 0 0 0 0999 V2000
15.7083 -14.7487 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.1211 -15.4585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5295 -14.7462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4153 -15.8713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8307 -15.8713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3505 -14.7410 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.1167 -14.0336 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.7053 -15.4666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8281 -16.6884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1178 -17.0978 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.5332 -17.1022 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.6971 -14.6480 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.9962 -15.8777 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8194 -18.6344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8194 -19.4516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5247 -19.8561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2300 -19.4516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2300 -18.6344 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5247 -18.2217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1123 -19.8612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9389 -18.2279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6454 -18.6386 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.9412 -17.4107 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.6430 -19.4558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3543 -18.2321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0608 -18.6427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3495 -19.8664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 2 1 0
2 5 1 0
3 6 1 0
3 7 2 0
4 8 1 0
5 9 1 0
9 10 1 0
9 11 2 0
8 12 2 0
8 13 1 0
14 15 1 0
14 19 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
15 20 1 0
18 21 1 0
21 22 1 0
21 23 2 0
22 24 1 0
22 25 1 0
25 26 1 0
24 27 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 198.31Molecular Weight (Monoisotopic): 198.1732AlogP: 2.18#Rotatable Bonds: 2Polar Surface Area: 23.55Molecular Species: NEUTRALHBA: 1HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 3HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 1.38CX LogD: 1.38Aromatic Rings: ┄Heavy Atoms: 14QED Weighted: 0.67Np Likeness Score: -1.53
References 1. Sashidhara KV, Rao KB, Kushwaha V, Modukuri RK, Verma R, Murthy PK.. (2014) Synthesis and antifilarial activity of chalcone-thiazole derivatives against a human lymphatic filarial parasite, Brugia malayi., 81 [PMID:24863844 ] [10.1016/j.ejmech.2014.05.029 ]