The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
rac-(4-(4'-Methoxy-[1,1'-biphenyl]-4-yl)-1H-1,2,3-triazol-1-yl)(2-(4-(3-(prop-2-yn-1-yloxy)propyl)phenyl)piperidin-1-yl)methanone ID: ALA3263572
PubChem CID: 90676906
Max Phase: Preclinical
Molecular Formula: C33H34N4O3
Molecular Weight: 534.66
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C#CCOCCCc1ccc(C2CCCCN2C(=O)n2cc(-c3ccc(-c4ccc(OC)cc4)cc3)nn2)cc1
Standard InChI: InChI=1S/C33H34N4O3/c1-3-22-40-23-6-7-25-9-11-29(12-10-25)32-8-4-5-21-36(32)33(38)37-24-31(34-35-37)28-15-13-26(14-16-28)27-17-19-30(39-2)20-18-27/h1,9-20,24,32H,4-8,21-23H2,2H3
Standard InChI Key: DSVGWNCZIVOVMK-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
16.3458 -5.4333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3458 -6.2583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0578 -6.6667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7699 -6.2583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7699 -5.4333 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.0578 -5.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4855 -5.0229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1987 -5.4370 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.4880 -4.1979 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.4327 -6.2246 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.2574 -6.2456 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.5323 -5.4677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8773 -4.9661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2501 -5.0602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9566 -5.4814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6738 -5.0752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6807 -4.2494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9646 -3.8314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2503 -4.2399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3979 -3.8417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1082 -4.2637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8248 -3.8565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8307 -3.0307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1140 -2.6136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4003 -3.0231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5474 -2.6219 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.2596 -3.0382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0578 -4.1917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7744 -3.7806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7747 -2.9564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0597 -2.5431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3429 -2.9600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3461 -3.7829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0586 -1.7181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3436 -1.3065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6297 -1.7200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9146 -1.3084 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.2008 -1.7219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4857 -1.3103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7708 -0.8988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
5 7 1 0
7 8 1 0
7 9 2 0
8 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
12 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
17 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
23 26 1 0
26 27 1 0
6 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
31 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
38 39 1 0
39 40 3 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 534.66Molecular Weight (Monoisotopic): 534.2631AlogP: 6.40#Rotatable Bonds: 9Polar Surface Area: 69.48Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 6.32CX LogD: 6.32Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.18Np Likeness Score: -0.77
References 1. Hsu KL, Tsuboi K, Chang JW, Whitby LR, Speers AE, Pugh H, Cravatt BF.. (2013) Discovery and optimization of piperidyl-1,2,3-triazole ureas as potent, selective, and in vivo-active inhibitors of α/β-hydrolase domain containing 6 (ABHD6)., 56 (21): [PMID:24152295 ] [10.1021/jm400899c ]