The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-cyclopropyl-N-(5-((3-(2-oxopyrrolidin-1-yl)propylamino)methyl)-2-(4-o-tolylpiperazin-1-yl)phenyl)oxazole-4-carboxamide ID: ALA3263693
PubChem CID: 90676910
Max Phase: Preclinical
Molecular Formula: C32H40N6O3
Molecular Weight: 556.71
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccccc1N1CCN(c2ccc(CNCCCN3CCCC3=O)cc2NC(=O)c2coc(C3CC3)n2)CC1
Standard InChI: InChI=1S/C32H40N6O3/c1-23-6-2-3-7-28(23)36-16-18-37(19-17-36)29-12-9-24(21-33-13-5-15-38-14-4-8-30(38)39)20-26(29)34-31(40)27-22-41-32(35-27)25-10-11-25/h2-3,6-7,9,12,20,22,25,33H,4-5,8,10-11,13-19,21H2,1H3,(H,34,40)
Standard InChI Key: HOFKLQRGJIWREF-UHFFFAOYSA-N
Molfile:
RDKit 2D
41 46 0 0 0 0 0 0 0 0999 V2000
30.6033 -11.9126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4188 -11.9138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8257 -11.2093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4183 -10.5032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5998 -10.5060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1965 -11.2110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6429 -11.2095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0516 -10.5019 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.1885 -9.7998 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.5944 -9.0906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1832 -8.3886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3770 -11.2146 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.9675 -10.5063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1539 -10.5068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7435 -11.2139 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.1530 -11.9222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9728 -11.9234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9262 -11.2177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5187 -10.5080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7023 -10.5070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2923 -11.2150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7047 -11.9253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5198 -11.9228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9298 -12.6298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8674 -10.5049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5128 -7.6409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9048 -7.1004 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.2028 -7.5117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3771 -8.3063 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.4533 -7.1804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9687 -6.5224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6411 -7.2711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2733 -11.2141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0905 -11.2171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4965 -11.9263 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.1652 -12.6705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7705 -13.2195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4797 -12.8135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3127 -12.0136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8611 -11.4078 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.4116 -9.0864 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
3 7 1 0
7 8 1 0
5 9 1 0
9 10 1 0
10 11 1 0
12 13 1 0
12 17 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
6 12 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
15 18 1 0
23 24 1 0
25 8 1 0
11 26 2 0
26 27 1 0
27 28 1 0
28 29 2 0
29 11 1 0
31 30 1 0
32 31 1 0
30 32 1 0
28 30 1 0
25 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
38 39 1 0
39 35 1 0
39 40 2 0
10 41 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 556.71Molecular Weight (Monoisotopic): 556.3162AlogP: 4.54#Rotatable Bonds: 11Polar Surface Area: 93.95Molecular Species: BASEHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.48CX Basic pKa: 9.05CX LogP: 3.75CX LogD: 2.10Aromatic Rings: 3Heavy Atoms: 41QED Weighted: 0.34Np Likeness Score: -1.31
References 1. Yu HN, Richardson TE, Nataraja S, Fischer DJ, Sriraman V, Jiang X, Bharathi P, Foglesong RJ, Haxell TF, Heasley BH, Jenks M, Li J, Dugas MS, Collis R, Tian H, Palmer S, Goutopoulos A.. (2014) Discovery of substituted benzamides as follicle stimulating hormone receptor allosteric modulators., 24 (9): [PMID:24685543 ] [10.1016/j.bmcl.2014.03.018 ]