The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-2-[4-(2-Amino-4-oxo-3,4,5,6,7,8-hexahydro-pyrido[2,3-d]pyrimidin-6-ylmethyl)-benzoylamino]-pentanedioic acid ID: ALA326511
PubChem CID: 136076368
Max Phase: Preclinical
Molecular Formula: C20H23N5O6
Molecular Weight: 429.43
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Nc1nc(O)c2c(n1)NCC(Cc1ccc(C(=O)N[C@H](CCC(=O)O)C(=O)O)cc1)C2
Standard InChI: InChI=1S/C20H23N5O6/c21-20-24-16-13(18(29)25-20)8-11(9-22-16)7-10-1-3-12(4-2-10)17(28)23-14(19(30)31)5-6-15(26)27/h1-4,11,14H,5-9H2,(H,23,28)(H,26,27)(H,30,31)(H4,21,22,24,25,29)/t11?,14-/m1/s1
Standard InChI Key: RPRBLFOFJVUMAP-SBXXRYSUSA-N
Molfile:
RDKit 2D
32 34 0 0 1 0 0 0 0 0999 V2000
-1.1125 -1.4042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8208 -1.8125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.1083 -0.5792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5333 -0.5792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.8208 -0.1542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5333 -1.4042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4000 -1.8167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9000 -1.8125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6125 -1.4000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.4292 -2.2250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3958 -0.1667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4292 -1.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1792 -1.4042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8208 0.6625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1292 0.6625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9042 -2.6375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7167 -2.6375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.2458 -1.8167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.4167 1.0750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.3167 -0.5875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4292 -0.5750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3167 -1.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4667 -1.8167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1792 -0.5750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1417 -0.1542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0292 -0.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1417 -2.6417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7500 -0.5875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8417 1.0875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4625 -0.1667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7542 -1.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2542 -1.4000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 1 1 0
4 5 1 0
5 3 2 0
6 2 1 0
7 1 1 0
8 13 1 0
9 8 1 0
12 10 1 6
11 3 1 0
12 9 1 1
13 23 1 0
14 5 1 0
15 25 1 0
16 8 2 0
17 10 2 0
18 6 1 0
19 15 2 0
20 22 1 0
12 21 1 6
22 7 1 0
23 31 2 0
24 30 1 0
25 21 1 0
26 20 1 0
27 10 1 0
28 26 1 0
29 15 1 0
30 28 2 0
31 28 1 0
12 32 1 1
6 4 2 0
11 20 1 0
24 13 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 429.43Molecular Weight (Monoisotopic): 429.1648AlogP: 0.64#Rotatable Bonds: 8Polar Surface Area: 187.76Molecular Species: ACIDHBA: 8HBD: 6#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 7#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.34CX Basic pKa: 3.83CX LogP: 0.95CX LogD: -5.07Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.35Np Likeness Score: 0.17
References 1. Shih C, Grindey G, Taylor E, Harrington P. (1992) Synthesis and biological activity of nor- and homo-5,10-dideazatetrahydrofolic acid, 2 (4): [10.1016/S0960-894X(01)80214-6 ]