The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-((S)-4-((Z)-2-(2-aminothiazol-4-yl)-2-((1,5-dihydroxy-4-oxo-1,4-dihydropyridin-2-yl)methoxyimino)acetamido)-3-oxoisoxazolidin-2-yl)-5-oxotetrahydrofuran-2-carboxylic acid ID: ALA3265221
PubChem CID: 90656110
Max Phase: Preclinical
Molecular Formula: C19H18N6O11S
Molecular Weight: 538.45
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Nc1nc(/C(=N/OCc2cc(=O)c(O)cn2O)C(=O)N[C@H]2CON(C3(C(=O)O)CCC(=O)O3)C2=O)cs1
Standard InChI: InChI=1S/C19H18N6O11S/c20-18-22-10(7-37-18)14(23-34-5-8-3-11(26)12(27)4-24(8)33)15(29)21-9-6-35-25(16(9)30)19(17(31)32)2-1-13(28)36-19/h3-4,7,9,27,33H,1-2,5-6H2,(H2,20,22)(H,21,29)(H,31,32)/b23-14-/t9-,19?/m0/s1
Standard InChI Key: ZSPXDBNKZMUCRF-JNHCFAHKSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
20.1774 -6.5935 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
20.9872 -6.4357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0893 -5.6169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3392 -5.2671 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.7795 -5.8720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9607 -5.7722 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.8113 -5.2176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5180 -5.6433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2399 -5.2440 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.5028 -6.4681 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.8264 -4.3927 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.5483 -3.9934 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.9467 -5.6695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0147 -6.4902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8185 -6.6766 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.2440 -5.9698 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.7033 -5.3467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3906 -7.0297 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.1421 -7.4356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7165 -8.1423 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.2572 -8.7655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0170 -8.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9457 -7.6219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0708 -9.5692 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.8831 -7.0797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5631 -7.5406 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.9449 -6.2567 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.5636 -3.1686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2855 -2.7693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9924 -3.1998 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.7121 -2.8040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7316 -1.9788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0250 -1.5511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2991 -1.9485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0430 -0.7263 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.4551 -1.5823 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.9742 -4.0246 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 1 1 0
5 6 1 0
3 7 1 0
7 8 1 0
8 9 1 0
8 10 2 0
7 11 2 0
11 12 1 0
13 9 1 1
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 13 1 0
14 18 2 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 19 1 0
15 19 1 0
21 24 2 0
19 25 1 0
25 26 1 0
25 27 2 0
12 28 1 0
28 29 1 0
29 30 1 0
29 34 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 1 0
33 35 2 0
32 36 1 0
30 37 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 538.45Molecular Weight (Monoisotopic): 538.0754AlogP: -1.87#Rotatable Bonds: 8Polar Surface Area: 245.20Molecular Species: ACIDHBA: 15HBD: 5#RO5 Violations: 2HBA (Lipinski): 17HBD (Lipinski): 6#RO5 Violations (Lipinski): 3CX Acidic pKa: 2.26CX Basic pKa: 3.32CX LogP: -2.31CX LogD: -4.60Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.11Np Likeness Score: 0.11
References 1. Starr J, Brown MF, Aschenbrenner L, Caspers N, Che Y, Gerstenberger BS, Huband M, Knafels JD, Lemmon MM, Li C, McCurdy SP, McElroy E, Rauckhorst MR, Tomaras AP, Young JA, Zaniewski RP, Shanmugasundaram V, Han S.. (2014) Siderophore receptor-mediated uptake of lactivicin analogues in gram-negative bacteria., 57 (9): [PMID:24694215 ] [10.1021/jm500219c ]