The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-2-[((S)-Pyrrolidine-2-carbonyl)-amino]-pentanedioic acid 5-amide 1-{[(S)-1-((S)-1-carbamoyl-2-phenyl-ethylcarbamoyl)-4-guanidino-butyl]-amide} ID: ALA326770
PubChem CID: 10030332
Max Phase: Preclinical
Molecular Formula: C25H39N9O5
Molecular Weight: 545.65
Molecule Type: Protein
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: NC(=O)CC[C@H](NC(=O)[C@@H]1CCCN1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](Cc1ccccc1)C(N)=O
Standard InChI: InChI=1S/C25H39N9O5/c26-20(35)11-10-18(33-22(37)16-8-4-12-30-16)24(39)32-17(9-5-13-31-25(28)29)23(38)34-19(21(27)36)14-15-6-2-1-3-7-15/h1-3,6-7,16-19,30H,4-5,8-14H2,(H2,26,35)(H2,27,36)(H,32,39)(H,33,37)(H,34,38)(H4,28,29,31)/t16-,17-,18-,19-/m0/s1
Standard InChI Key: VVKYIUFJEDANQO-VJANTYMQSA-N
Molfile:
RDKit 2D
39 40 0 0 1 0 0 0 0 0999 V2000
7.1667 -3.8042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3125 -4.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0250 -4.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0167 -3.8042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.7417 -3.8042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.8792 -4.2167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.0167 -0.5042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7417 -4.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4542 -3.8042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4542 -4.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5917 -3.8042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7417 -6.2792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3125 -0.0917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.5917 -4.2167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.3125 -3.8042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1667 -2.9792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3125 -5.0417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0250 -5.0417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.7417 -5.0417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4542 -2.9792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4542 -6.6917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4542 -5.0417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0167 -1.3292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.7417 -0.0917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.1667 -4.2167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.7417 -5.4542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0250 -6.6917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.3250 -5.7542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1792 -3.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5917 -2.9792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3125 -1.7417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3125 -2.9792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5000 -5.7417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7250 -6.4625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3125 -2.5667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3917 -2.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3125 -7.1667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0792 -6.4500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4792 -7.1667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 11 1 0
3 5 1 0
4 2 1 0
10 5 1 6
6 1 1 0
7 23 2 0
8 4 1 6
9 8 1 0
10 1 1 0
11 6 1 1
12 26 1 0
13 7 1 0
14 15 1 0
15 3 1 1
16 1 2 0
17 2 2 0
18 3 2 0
8 19 1 0
20 9 2 0
21 12 2 0
10 22 1 0
23 31 1 0
24 7 1 0
25 9 1 0
26 22 1 0
27 12 1 0
28 19 1 0
29 14 1 0
11 30 1 0
31 35 1 0
15 32 1 0
33 28 2 0
34 28 1 0
35 30 1 0
36 32 1 0
37 34 2 0
38 33 1 0
39 37 1 0
36 29 1 0
39 38 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: ProteinTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 545.65Molecular Weight (Monoisotopic): 545.3074AlogP: -2.76#Rotatable Bonds: 16Polar Surface Area: 249.91Molecular Species: BASEHBA: 7HBD: 8#RO5 Violations: 2HBA (Lipinski): 14HBD (Lipinski): 12#RO5 Violations (Lipinski): 3CX Acidic pKa: 11.89CX Basic pKa: 10.80CX LogP: -3.25CX LogD: -7.43Aromatic Rings: 1Heavy Atoms: 39QED Weighted: 0.06Np Likeness Score: 0.25
References 1. Gicquel S, Mazarguil H, Desprat C, Allard M, Devillers JP, Simonnet G, Zajac JM.. (1994) Structure-activity study of neuropeptide FF: contribution of N-terminal regions to affinity and activity., 37 (21): [PMID:7932576 ] [10.1021/jm00047a005 ] 2. Nguyen T,Marusich J,Li JX,Zhang Y. (2020) Neuropeptide FF and Its Receptors: Therapeutic Applications and Ligand Development., 63 (21.0): [PMID:32673481 ] [10.1021/acs.jmedchem.0c00643 ]