The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
ethyl 2-((S)-1-((S)-2-((S)-1-acetylpyrrolidine-2-carboxamido)propanoyl)pyrrolidine-2-carbonyl)hydrazinecarboxylate ID: ALA3272359
PubChem CID: 90677661
Max Phase: Preclinical
Molecular Formula: C18H29N5O6
Molecular Weight: 411.46
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)NNC(=O)[C@@H]1CCCN1C(=O)[C@H](C)NC(=O)[C@@H]1CCCN1C(C)=O
Standard InChI: InChI=1S/C18H29N5O6/c1-4-29-18(28)21-20-16(26)14-8-6-10-23(14)17(27)11(2)19-15(25)13-7-5-9-22(13)12(3)24/h11,13-14H,4-10H2,1-3H3,(H,19,25)(H,20,26)(H,21,28)/t11-,13-,14-/m0/s1
Standard InChI Key: HHBAWUXHCAQVDM-UBHSHLNASA-N
Molfile:
RDKit 2D
29 30 0 0 0 0 0 0 0 0999 V2000
11.2680 -2.4755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3980 -3.6659 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.8900 -4.9491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2032 -4.5174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2861 -4.9970 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.8612 -5.7564 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.1458 -6.1424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2701 -3.2925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6303 -3.7579 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7135 -6.8964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4550 -5.7108 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.6989 -3.2557 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.9976 -3.6659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9976 -4.4736 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.0083 -3.1385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1013 -2.4439 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.1013 -3.2557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3962 -2.3513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5017 -3.2557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7474 -6.0808 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.8026 -3.6659 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.6056 -4.5693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2011 -3.6606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9918 -7.2798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1232 -6.9573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4063 -7.3236 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.5331 -8.1186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3284 -8.2437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6930 -7.5260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3 22 1 0
8 1 1 0
7 11 2 0
17 21 1 0
21 19 1 0
26 10 1 0
22 9 1 0
12 2 1 0
17 16 2 0
6 3 1 0
10 20 2 0
2 17 1 0
22 5 2 0
25 7 1 6
13 14 2 0
13 12 1 0
15 18 1 0
7 6 1 0
15 9 1 0
8 13 1 1
18 1 1 0
9 8 1 0
3 4 1 1
19 23 1 0
10 24 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 25 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 411.46Molecular Weight (Monoisotopic): 411.2118AlogP: -0.73#Rotatable Bonds: 5Polar Surface Area: 137.15Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.14CX Basic pKa: ┄CX LogP: -1.71CX LogD: -1.71Aromatic Rings: ┄Heavy Atoms: 29QED Weighted: 0.51Np Likeness Score: -1.04
References 1. Dorn CP, Zimmerman M, Yang SS, Yurewicz EC, Ashe BM, Frankshun R, Jones H.. (1977) Proteinase inhibitors. I. Inhibitors of elastase., 20 (11): [PMID:915907 ] [10.1021/jm00221a020 ]