The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N4-(6-methoxy-2-(4-(trifluoromethyl)benzyloxy)quinolin-8-yl)pentane-1,4-diamine maleate ID: ALA3272374
PubChem CID: 90678560
Max Phase: Preclinical
Molecular Formula: C27H30F3N3O6
Molecular Weight: 433.47
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(NC(C)CCCN)c2nc(OCc3ccc(C(F)(F)F)cc3)ccc2c1.O=C(O)/C=C\C(=O)O
Standard InChI: InChI=1S/C23H26F3N3O2.C4H4O4/c1-15(4-3-11-27)28-20-13-19(30-2)12-17-7-10-21(29-22(17)20)31-14-16-5-8-18(9-6-16)23(24,25)26;5-3(6)1-2-4(7)8/h5-10,12-13,15,28H,3-4,11,14,27H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1-
Standard InChI Key: KPTDHRDVIXCPKF-BTJKTKAUSA-N
Molfile:
RDKit 2D
39 40 0 0 0 0 0 0 0 0999 V2000
11.4911 -2.2982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0786 -3.0127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2536 -3.0127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8411 -2.2982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0786 -1.5837 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.3161 -2.2982 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0161 -2.2982 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.2536 -1.5837 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2985 -3.0291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2974 -3.8565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0121 -4.2694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0103 -2.6163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7257 -3.0255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7265 -3.8523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4417 -4.2632 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.1568 -3.8485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1521 -3.0185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4362 -2.6113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5839 -2.6167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5837 -1.7917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8729 -4.2583 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.5857 -3.8429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3018 -4.2527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3003 -5.0760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0155 -5.4857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7294 -5.0703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7235 -4.2411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0077 -3.8352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4460 -5.4791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0141 -5.0943 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3005 -5.5085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3024 -6.3335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5851 -5.0976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8716 -5.5118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1562 -5.1009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4427 -5.5150 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.4503 -6.3041 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
13.1583 -5.0629 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
13.1582 -5.8916 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
1 5 2 0
1 6 1 0
4 7 2 0
4 8 1 0
9 10 2 0
10 11 1 0
11 14 2 0
13 12 2 0
12 9 1 0
13 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
9 19 1 0
19 20 1 0
16 21 1 0
21 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
26 29 1 0
11 30 1 0
30 31 1 0
31 32 1 0
31 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
29 37 1 0
29 38 1 0
29 39 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 433.47Molecular Weight (Monoisotopic): 433.1977AlogP: 5.38#Rotatable Bonds: 9Polar Surface Area: 69.40Molecular Species: BASEHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 10.20CX LogP: 4.68CX LogD: 2.08Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.47Np Likeness Score: -0.80
References 1. Shetty RV, Wetter WP, Blanton CD.. (1977) Synthesis of 2-benzyloxy and 2-benzylthio analogues of primaquine as potential antimalarials., 20 (10): [PMID:409843 ] [10.1021/jm00220a025 ]