The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
ethyl 2-((S)-1-((S)-2-((S)-2-acetamidopropanamido)propanoyl)pyrrolidine-2-carbonyl)hydrazinecarboxylate ID: ALA3272695
PubChem CID: 90677660
Max Phase: Preclinical
Molecular Formula: C16H27N5O6
Molecular Weight: 385.42
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)NNC(=O)[C@@H]1CCCN1C(=O)[C@H](C)NC(=O)[C@H](C)NC(C)=O
Standard InChI: InChI=1S/C16H27N5O6/c1-5-27-16(26)20-19-14(24)12-7-6-8-21(12)15(25)10(3)18-13(23)9(2)17-11(4)22/h9-10,12H,5-8H2,1-4H3,(H,17,22)(H,18,23)(H,19,24)(H,20,26)/t9-,10-,12-/m0/s1
Standard InChI Key: KFKNRAGFNFQUID-NHCYSSNCSA-N
Molfile:
RDKit 2D
27 27 0 0 0 0 0 0 0 0999 V2000
11.2680 -2.4755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3980 -3.6659 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.8900 -4.9491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2032 -4.5174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2861 -4.9970 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.8612 -5.7564 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.1458 -6.1424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2701 -3.2925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6303 -3.7579 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7135 -6.8964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4550 -5.7108 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.6989 -3.2557 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.9976 -3.6659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9976 -4.4736 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.0083 -3.1385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1013 -2.4439 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.1013 -3.2557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3962 -2.3513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5017 -3.2557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7474 -6.0808 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.8026 -3.6659 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.6056 -4.5693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2011 -3.6606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1213 -6.9539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4063 -7.3236 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.8128 -7.3893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9918 -7.2798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3 22 1 0
8 1 1 0
7 11 2 0
17 21 1 0
21 19 1 0
25 10 1 0
22 9 1 0
12 2 1 0
17 16 2 0
6 3 1 0
10 20 2 0
2 17 1 0
22 5 2 0
24 7 1 0
13 14 2 0
13 12 1 0
15 18 1 0
7 6 1 0
15 9 1 0
8 13 1 1
18 1 1 0
9 8 1 0
3 4 1 1
19 23 1 0
24 25 1 0
24 26 1 6
10 27 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 385.42Molecular Weight (Monoisotopic): 385.1961AlogP: -1.22#Rotatable Bonds: 6Polar Surface Area: 145.94Molecular Species: NEUTRALHBA: 6HBD: 4#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.30CX Basic pKa: ┄CX LogP: -1.98CX LogD: -1.98Aromatic Rings: ┄Heavy Atoms: 27QED Weighted: 0.42Np Likeness Score: -1.12
References 1. Dorn CP, Zimmerman M, Yang SS, Yurewicz EC, Ashe BM, Frankshun R, Jones H.. (1977) Proteinase inhibitors. I. Inhibitors of elastase., 20 (11): [PMID:915907 ] [10.1021/jm00221a020 ]