The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N4-(6-methoxy-4-propylquinolin-8-yl)pentane-1,4-diamine but-2-enedioic acid ID: ALA3273113
PubChem CID: 90677967
Max Phase: Preclinical
Molecular Formula: C22H31N3O5
Molecular Weight: 301.43
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCc1ccnc2c(NC(C)CCCN)cc(OC)cc12.O=C(O)/C=C/C(=O)O
Standard InChI: InChI=1S/C18H27N3O.C4H4O4/c1-4-6-14-8-10-20-18-16(14)11-15(22-3)12-17(18)21-13(2)7-5-9-19;5-3(6)1-2-4(7)8/h8,10-13,21H,4-7,9,19H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1+
Standard InChI Key: RSRVFDMQKUFXEH-WLHGVMLRSA-N
Molfile:
RDKit 2D
30 30 0 0 0 0 0 0 0 0999 V2000
17.7110 -11.6629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4188 -11.2543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0032 -11.2543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2954 -11.6629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2954 -12.4802 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.1266 -11.6629 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.4188 -10.4370 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.5877 -11.2543 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.7536 -11.5552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7524 -12.3826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4673 -12.7956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4655 -11.1424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1810 -11.5515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1817 -12.3785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8972 -12.7894 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.6122 -12.3746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6074 -11.5446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8916 -11.1373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8871 -10.3123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0390 -11.1428 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0388 -10.3177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4692 -13.6206 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.1848 -14.0315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1867 -14.8566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8983 -13.6173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6138 -14.0281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3273 -13.6139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0429 -14.0249 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.5994 -9.8960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5950 -9.0709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 2 0
3 4 1 0
4 5 2 0
2 6 2 0
2 7 1 0
4 8 1 0
9 10 2 0
10 11 1 0
11 14 2 0
13 12 2 0
12 9 1 0
13 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
18 19 1 0
9 20 1 0
20 21 1 0
11 22 1 0
22 23 1 0
23 24 1 0
23 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
19 29 1 0
29 30 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 301.43Molecular Weight (Monoisotopic): 301.2154AlogP: 3.74#Rotatable Bonds: 8Polar Surface Area: 60.17Molecular Species: BASEHBA: 4HBD: 2#RO5 Violations: ┄HBA (Lipinski): 4HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 10.20CX LogP: 3.05CX LogD: 0.44Aromatic Rings: 2Heavy Atoms: 22QED Weighted: 0.78Np Likeness Score: -0.12
References 1. Carroll FI, Berrang BD, Linn CP.. (1979) Synthesis of 4-alkyl and 4-(beta-alkylvinyl) derivatives of primaquine as potential antimalarials., 22 (11): [PMID:118257 ] [10.1021/jm00197a016 ]