The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N4-(4-(3-cyclohexylpropyl)-6-methoxyquinolin-8-yl)pentane-1,4-diamine but-2-enedioic acid ID: ALA3273115
PubChem CID: 90677969
Max Phase: Preclinical
Molecular Formula: C28H41N3O5
Molecular Weight: 383.58
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(NC(C)CCCN)c2nccc(CCCC3CCCCC3)c2c1.O=C(O)/C=C/C(=O)O
Standard InChI: InChI=1S/C24H37N3O.C4H4O4/c1-18(8-7-14-25)27-23-17-21(28-2)16-22-20(13-15-26-24(22)23)12-6-11-19-9-4-3-5-10-19;5-3(6)1-2-4(7)8/h13,15-19,27H,3-12,14,25H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1+
Standard InChI Key: DIIHSOYKKILCQF-WLHGVMLRSA-N
Molfile:
RDKit 2D
36 37 0 0 0 0 0 0 0 0999 V2000
24.7189 -11.6617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4266 -11.2531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0112 -11.2531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3035 -11.6617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3035 -12.4789 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.1344 -11.6617 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.4266 -10.4359 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.5958 -11.2531 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.2775 -12.8331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2763 -13.6605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9911 -14.0733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9893 -12.4204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7046 -12.8294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7054 -13.6562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4207 -14.0672 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.1358 -13.6525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1310 -12.8226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4151 -12.4153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4107 -11.5903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5629 -12.4208 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.5627 -11.5958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9930 -14.8983 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.7084 -15.3092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7103 -16.1342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4219 -14.8949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1374 -15.3058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8508 -14.8917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5663 -15.3025 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.1229 -11.1741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1186 -10.3491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8308 -9.9328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5427 -10.3435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2528 -9.9308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2527 -9.1054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5362 -8.6946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8198 -9.1091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 2 0
3 4 1 0
4 5 2 0
2 6 2 0
2 7 1 0
4 8 1 0
9 10 2 0
10 11 1 0
11 14 2 0
13 12 2 0
12 9 1 0
13 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
18 19 1 0
9 20 1 0
20 21 1 0
11 22 1 0
22 23 1 0
23 24 1 0
23 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
19 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
31 36 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 383.58Molecular Weight (Monoisotopic): 383.2937AlogP: 5.69#Rotatable Bonds: 10Polar Surface Area: 60.17Molecular Species: BASEHBA: 4HBD: 2#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 10.20CX LogP: 5.09CX LogD: 2.49Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.55Np Likeness Score: 0.06
References 1. Carroll FI, Berrang BD, Linn CP.. (1979) Synthesis of 4-alkyl and 4-(beta-alkylvinyl) derivatives of primaquine as potential antimalarials., 22 (11): [PMID:118257 ] [10.1021/jm00197a016 ]