N4-(4-(3-cyclohexylpropyl)-6-methoxyquinolin-8-yl)pentane-1,4-diamine but-2-enedioic acid

ID: ALA3273115

PubChem CID: 90677969

Max Phase: Preclinical

Molecular Formula: C28H41N3O5

Molecular Weight: 383.58

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(NC(C)CCCN)c2nccc(CCCC3CCCCC3)c2c1.O=C(O)/C=C/C(=O)O

Standard InChI:  InChI=1S/C24H37N3O.C4H4O4/c1-18(8-7-14-25)27-23-17-21(28-2)16-22-20(13-15-26-24(22)23)12-6-11-19-9-4-3-5-10-19;5-3(6)1-2-4(7)8/h13,15-19,27H,3-12,14,25H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1+

Standard InChI Key:  DIIHSOYKKILCQF-WLHGVMLRSA-N

Molfile:  

     RDKit          2D

 36 37  0  0  0  0  0  0  0  0999 V2000
   24.7189  -11.6617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4266  -11.2531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0112  -11.2531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3035  -11.6617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3035  -12.4789    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.1344  -11.6617    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.4266  -10.4359    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.5958  -11.2531    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.2775  -12.8331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2763  -13.6605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9911  -14.0733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9893  -12.4204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7046  -12.8294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7054  -13.6562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4207  -14.0672    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.1358  -13.6525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1310  -12.8226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4151  -12.4153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4107  -11.5903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5629  -12.4208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.5627  -11.5958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9930  -14.8983    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.7084  -15.3092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7103  -16.1342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4219  -14.8949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1374  -15.3058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8508  -14.8917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5663  -15.3025    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.1229  -11.1741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1186  -10.3491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8308   -9.9328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5427  -10.3435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2528   -9.9308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2527   -9.1054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5362   -8.6946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8198   -9.1091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  2  0
  3  4  1  0
  4  5  2  0
  2  6  2  0
  2  7  1  0
  4  8  1  0
  9 10  2  0
 10 11  1  0
 11 14  2  0
 13 12  2  0
 12  9  1  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
 18 19  1  0
  9 20  1  0
 20 21  1  0
 11 22  1  0
 22 23  1  0
 23 24  1  0
 23 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 19 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 31 36  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
M  END

Associated Targets(non-human)

Plasmodium cynomolgi (553 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Plasmodium berghei (192651 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Leishmania donovani (89745 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 383.58Molecular Weight (Monoisotopic): 383.2937AlogP: 5.69#Rotatable Bonds: 10
Polar Surface Area: 60.17Molecular Species: BASEHBA: 4HBD: 2
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 10.20CX LogP: 5.09CX LogD: 2.49
Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.55Np Likeness Score: 0.06

References

1. Carroll FI, Berrang BD, Linn CP..  (1979)  Synthesis of 4-alkyl and 4-(beta-alkylvinyl) derivatives of primaquine as potential antimalarials.,  22  (11): [PMID:118257] [10.1021/jm00197a016]

Source