Bis(3-(diisopentylamino)propyl)dibenzo[b,d]thiophene-2,7-dicarboxylate dihydrochloride

ID: ALA3273719

PubChem CID: 90678283

Max Phase: Preclinical

Molecular Formula: C40H63ClN2O4S

Molecular Weight: 667.01

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)CCN(CCCOC(=O)c1ccc2c(c1)sc1ccc(C(=O)OCCCN(CCC(C)C)CCC(C)C)cc12)CCC(C)C.Cl

Standard InChI:  InChI=1S/C40H62N2O4S.ClH/c1-29(2)15-21-41(22-16-30(3)4)19-9-25-45-39(43)33-12-14-37-36(27-33)35-13-11-34(28-38(35)47-37)40(44)46-26-10-20-42(23-17-31(5)6)24-18-32(7)8;/h11-14,27-32H,9-10,15-26H2,1-8H3;1H

Standard InChI Key:  OUDISWOEBJCJQR-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 48 49  0  0  0  0  0  0  0  0999 V2000
   14.1523   -6.7794    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    7.5945   -6.2575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5415   -7.0854    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.9031   -5.8028    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1653   -6.1691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4799   -5.7224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7459   -6.0914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0532   -5.6371    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.1002   -4.8164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3142   -6.0060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8332   -4.4457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6240   -5.5483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8898   -5.9179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8453   -6.7407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8895   -3.6251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2041   -3.1674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6308   -3.2541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1991   -5.4633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1774   -3.4190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3902   -5.0836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3419   -5.8964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0367   -6.3527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1257   -4.7070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8139   -5.1571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7677   -5.9767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5374   -6.2718    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   10.6099   -4.9435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0524   -5.6416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8812   -5.6044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2657   -4.8738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8109   -4.1682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9861   -4.2110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0029   -3.3626    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.7181   -2.7318    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.3690   -2.6274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1945   -2.5752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5688   -1.8440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3984   -1.8002    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.7769   -1.0608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8413   -2.4875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4626   -3.2227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5980   -1.0221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9124   -3.9150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5397   -4.6511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9761   -0.2888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8026   -0.2459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7427   -3.8665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5338    0.4070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  2  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  8 10  1  0
  9 11  1  0
 10 12  1  0
 12 13  1  0
 13 14  1  0
 11 15  1  0
 15 16  1  0
 15 17  1  0
 13 18  1  0
 20 21  2  0
 21 22  1  0
 22 25  2  0
 24 23  2  0
 23 20  1  0
 24 25  1  0
 25 26  1  0
 26 28  1  0
 27 24  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
 31 19  1  0
 19 33  1  0
 19 34  2  0
 33 35  1  0
 35 36  1  0
 36 37  1  0
 37 38  1  0
 38 39  1  0
 38 40  1  0
 40 41  1  0
 39 42  1  0
 41 43  1  0
 43 44  1  0
 42 45  1  0
 45 46  1  0
 43 47  1  0
 45 48  1  0
 21  2  1  0
M  END

Associated Targets(non-human)

Encephalomyocarditis virus (292 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 667.01Molecular Weight (Monoisotopic): 666.4430AlogP: 9.94#Rotatable Bonds: 22
Polar Surface Area: 59.08Molecular Species: BASEHBA: 7HBD:
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 10.93CX LogP: 10.55CX LogD: 4.46
Aromatic Rings: 3Heavy Atoms: 47QED Weighted: 0.08Np Likeness Score: -0.55

References

1. Albrecht WL, Fleming RW, Horgan SW, Mayer GD..  (1977)  Bis-basic-substituted polycyclic aromatic compounds. A new class of antiviral agents. 8. Bis-basic derivatives of carbazole, dibenzofuran, and dibenzothiophene.,  20  (3): [PMID:191610] [10.1021/jm00213a011]

Source