The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Bis(3-(diisopentylamino)propyl)dibenzo[b,d]thiophene-2,7-dicarboxylate dihydrochloride ID: ALA3273719
PubChem CID: 90678283
Max Phase: Preclinical
Molecular Formula: C40H63ClN2O4S
Molecular Weight: 667.01
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)CCN(CCCOC(=O)c1ccc2c(c1)sc1ccc(C(=O)OCCCN(CCC(C)C)CCC(C)C)cc12)CCC(C)C.Cl
Standard InChI: InChI=1S/C40H62N2O4S.ClH/c1-29(2)15-21-41(22-16-30(3)4)19-9-25-45-39(43)33-12-14-37-36(27-33)35-13-11-34(28-38(35)47-37)40(44)46-26-10-20-42(23-17-31(5)6)24-18-32(7)8;/h11-14,27-32H,9-10,15-26H2,1-8H3;1H
Standard InChI Key: OUDISWOEBJCJQR-UHFFFAOYSA-N
Molfile:
RDKit 2D
48 49 0 0 0 0 0 0 0 0999 V2000
14.1523 -6.7794 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
7.5945 -6.2575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5415 -7.0854 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.9031 -5.8028 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1653 -6.1691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4799 -5.7224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7459 -6.0914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0532 -5.6371 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.1002 -4.8164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3142 -6.0060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8332 -4.4457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6240 -5.5483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8898 -5.9179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8453 -6.7407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8895 -3.6251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2041 -3.1674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6308 -3.2541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1991 -5.4633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1774 -3.4190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3902 -5.0836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3419 -5.8964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0367 -6.3527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1257 -4.7070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8139 -5.1571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7677 -5.9767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5374 -6.2718 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
10.6099 -4.9435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0524 -5.6416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8812 -5.6044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2657 -4.8738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8109 -4.1682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9861 -4.2110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0029 -3.3626 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.7181 -2.7318 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.3690 -2.6274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1945 -2.5752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5688 -1.8440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3984 -1.8002 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.7769 -1.0608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8413 -2.4875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4626 -3.2227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5980 -1.0221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9124 -3.9150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5397 -4.6511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9761 -0.2888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8026 -0.2459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7427 -3.8665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5338 0.4070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
2 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
8 10 1 0
9 11 1 0
10 12 1 0
12 13 1 0
13 14 1 0
11 15 1 0
15 16 1 0
15 17 1 0
13 18 1 0
20 21 2 0
21 22 1 0
22 25 2 0
24 23 2 0
23 20 1 0
24 25 1 0
25 26 1 0
26 28 1 0
27 24 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
31 19 1 0
19 33 1 0
19 34 2 0
33 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
38 39 1 0
38 40 1 0
40 41 1 0
39 42 1 0
41 43 1 0
43 44 1 0
42 45 1 0
45 46 1 0
43 47 1 0
45 48 1 0
21 2 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 667.01Molecular Weight (Monoisotopic): 666.4430AlogP: 9.94#Rotatable Bonds: 22Polar Surface Area: 59.08Molecular Species: BASEHBA: 7HBD: ┄#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 10.93CX LogP: 10.55CX LogD: 4.46Aromatic Rings: 3Heavy Atoms: 47QED Weighted: 0.08Np Likeness Score: -0.55
References 1. Albrecht WL, Fleming RW, Horgan SW, Mayer GD.. (1977) Bis-basic-substituted polycyclic aromatic compounds. A new class of antiviral agents. 8. Bis-basic derivatives of carbazole, dibenzofuran, and dibenzothiophene., 20 (3): [PMID:191610 ] [10.1021/jm00213a011 ]